Wikidata entity: Q100429558
C₉H₁₁N (P274)
Quantities
| P2067 | mass | 133.089149352 |
| P233 | canonical SMILES | String | C1C(C1N)C2=CC=CC=C2 | ??? |
| P1889 | different from | ... | Q420885 (tranylcypromine) | tranylcypromine |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1[C@@H]([C@H]1N)C2=CC=CC=C2 | ??? |
| P361 | part of | ... | Q420885 (tranylcypromine) | tranylcypromine |
| P3364 | stereoisomer of | ... | Q27280143 ((1R,2R)-2-phenylcyclopropan-1-amine) | (1R,2R)-2-phenylcyclopropan-1-amine |
| P3364 | stereoisomer of | ... | Q100429273 (trans-(+)-tranylcypromine) | trans-(+)-tranylcypromine |
| P3364 | stereoisomer of | ... | Q100430420 ((1S,2S)-2-phenylcyclopropan-1-amine) | (1S,2S)-2-phenylcyclopropan-1-amine |
| P279 | subclass of | ... | Q27163528 ((2S)-2-phenylcyclopropan-1-amine) | (2S)-2-phenylcyclopropan-1-amine |
| P231 | CAS Registry Number | 3721-26-4 |
| P683 | ChEBI ID | 131511 |
| P592 | ChEMBL ID | CHEMBL257990 |
| P661 | ChemSpider ID | 24284 |
| P3117 | DSSTox substance ID | DTXSID801315454 |
| P234 | InChI | InChI=1S/C9H11N/c10-9-6-8(9)7-4-2-1-3-5-7/h1-5,8-9H,6,10H2/t8-,9+/m1/s1 |
| P235 | InChIKey | AELCINSCMGFISI-BDAKNGLRSA-N |
| P2085 | Nikkaji ID | J9.123E |
| P11199 | Probes And Drugs ID | PD013254 |
| P662 | PubChem CID | 26070 |
| P2877 | SureChEMBL ID | 145650 |
| P11089 | UniChem compound ID | 444442 |
Why not click here or view trends?
log id: 2253742