type of chemical entity | Q113145171 |
2-(3,4-Dihydroxyphenyl)-6-(3,7-dimethylocta-2,6-dienyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one | Q105271112 |
P233 | canonical SMILES | O=C1C2=C(O)C(=C(O)C=C2OC(C3=CC=C(O)C(O)=C3)C1O)CC=C(C)CCC=C(C)C |
P234 | InChI | InChI=1S/C25H28O7/c1-13(2)5-4-6-14(3)7-9-16-18(27)12-20-21(22(16)29)23(30)24(31)25(32-20)15-8-10-17(26)19(28)11-15/h5,7-8,10-12,24-29,31H,4,6,9H2,1-3H3/b14-7+/t24-,25+/m0/s1 |
P235 | InChIKey | UESFDRVOHWXYIQ-PRANAVDNSA-N |
P2017 | isomeric SMILES | CC(C)=CCC/C(C)=C/Cc1c(O)cc2c(c1O)C(=O)[C@H](O)[C@@H](c1ccc(O)c(O)c1)O2 |
P9405 | NMRShiftDB structure ID | 10019204 |
P662 | PubChem CID | 639466 |
P2877 | SureChEMBL ID | SCHEMBL6319079 |
P11089 | UniChem compound ID | 551198 |
P703 | found in taxon | Paulownia tomentosa | Q157393 |
Mimulus clevelandii | Q3028871 | ||
Macaranga alnifolia | Q15357562 | ||
P2067 | mass | 440.183503236 | |
P3364 | stereoisomer of | (2S,3S)-2-(3,4-dihydroxyphenyl)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5,7-trihydroxy-2,3-dihydrochromen-4-one | Q105271108 |
(2R,3R)-2-(3,4-dihydroxyphenyl)-6-(3,7-dimethylocta-2,6-dienyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one | Q105271109 |
Q105271109 | (2R,3R)-2-(3,4-dihydroxyphenyl)-6-(3,7-dimethylocta-2,6-dienyl)-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
Q105271108 | (2S,3S)-2-(3,4-dihydroxyphenyl)-6-[(2E)-3,7-dimethylocta-2,6-dienyl]-3,5,7-trihydroxy-2,3-dihydrochromen-4-one |
Q37038358 | Antiproliferative prenylated stilbenes and flavonoids from Macaranga alnifolia from the Madagascar rainforest |
Q45098888 | C-geranyl compounds from Mimulus clevelandii |
Q46800399 | Geranylated flavanones from the secretion on the surface of the immature fruits of Paulownia tomentosa |
Search more.