Wikidata entity: Q104996435
C₁₅H₂₀O₅ (P274)
Quantities
| P2067 | mass | 280.13107374 |
| P233 | canonical SMILES | String | O=C1C=C(CO)C2C3OC(=O)C(O)(C)C3CCC(C)C12 | ??? |
| P703 | found in taxon | ... | Q15231365 (Parasenecio petasitoides) | Parasenecio petasitoides |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@H]1CC[C@@H]2[C@H](OC(=O)[C@]2(C)O)[C@H]2C(CO)=CC(=O)[C@@H]12 | ??? |
| P279 | subclass of | ... | Q104996436 (3-hydroxy-9-(hydroxymethyl)-3,6-dimethyl-4,5,6,6a,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2,7-dione) | 3-hydroxy-9-(hydroxymethyl)-3,6-dimethyl-4,5,6,6a,9a,9b-hexahydro-3aH-azuleno[4,5-b]furan-2,7-dione |
Why not click here or view trends?
log id: 4218741