Wikidata entity: Q104996749
C₉H₁₇NO₅ (P274)
Quantities
| P2067 | mass | 219.110672644 |
| P233 | canonical SMILES | String | OCC1N2C(CO)C(O)C(O)C2C(O)C1 | ??? |
| P703 | found in taxon | ... | Q3497414 (Ledebouria socialis) | Ledebouria socialis |
| P703 | found in taxon | ... | Q15504435 (Scilla sodalicia) | Scilla sodalicia |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | OC[C@@H]1C[C@@H](O)[C@@H]2[C@H](O)[C@H](O)[C@@H](CO)N12 | ??? |
| P3364 | stereoisomer of | ... | Q104996748 (hyacinthacine C2) | hyacinthacine C2 |
| P279 | subclass of | ... | Q75005794 (pyrrolizidine alkaloid) | pyrrolizidine alkaloid |
| P234 | InChI | InChI=1S/C9H17NO5/c11-2-4-1-6(13)7-9(15)8(14)5(3-12)10(4)7/h4-9,11-15H,1-3H2/t4-,5+,6+,7+,8+,9-/m0/s1 |
| P235 | InChIKey | FKQQQROPNALGDM-ZLFMKPOPSA-N |
| P662 | PubChem CID | 16737238 |
| P11089 | UniChem compound ID | 313103 |
Why not click here or view trends?
log id: 5550439