Wikidata entity: Q105103071
C₅₈H₈₂N₁₂O₁₃ (P274)
Quantities
| P2067 | mass | 1154.612430684 |
| P233 | canonical SMILES | String | CC(C)=CCOc1ccc(CC2NC(=O)C3CCCN3C(=O)C(C(C)C)NC(=O)CNC(=O)C(Cc3ccccc3)NC(=O)C(CC(N)=O)NC(=O)C(CCC(N)=O)NC(=O)C(CC(C)C)NC(=O)C3CCCN3C(=O)C(C)NC2=O)cc1 | ??? |
| P703 | found in taxon | ... | Q133353 (Anabaena) | Anabaena |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC(C)=CCOc1ccc(C[C@@H]2NC(=O)[C@@H]3CCCN3C(=O)[C@H](C(C)C)NC(=O)CNC(=O)[C@H](Cc3ccccc3)NC(=O)[C@H](CC(N)=O)NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H]3CCCN3C(=O)[C@H](C)NC2=O)cc1 | ??? |
| P279 | subclass of | ... | Q109559114 (biogenic cyclopeptide) | biogenic cyclopeptide |
Why not click here or view trends?
log id: 4041723