Wikidata entity: Q105202422
C₃₅H₅₆O₁₃ (P274)
Quantities
| P2067 | mass | 684.372091852 |
| P233 | canonical SMILES | String | O=C(OC1CC2(O)C(O)CC3C(CCC4(C)C3CC5OC6(OCC(C)C(O)C6)C(C)C54)C2(C)CC1OC7OC(CO)C(O)C(O)C7O)C | ??? |
| P703 | found in taxon | ... | Q736155 (Allium giganteum) | Allium giganteum |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC(=O)O[C@@H]1C[C@]2(O)[C@H](O)C[C@H]3[C@@H]4C[C@@H]5O[C@]6(C[C@H](O)[C@@H](C)CO6)[C@@H](C)[C@@H]5[C@@]4(C)CC[C@@H]3[C@@]2(C)C[C@H]1O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O | ??? |
| P279 | subclass of | ... | Q105202423 (4,18',19'-trihydroxy-5,7',9',13'-tetramethyl-15'-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-5'-oxaspiro[oxane-2,6'-pentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan]-16'-yl acetate) | 4,18',19'-trihydroxy-5,7',9',13'-tetramethyl-15'-{[3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy}-5'-oxaspiro[oxane-2,6'-pentacyclo[10.8.0.0²,⁹.0⁴,⁸.0¹³,¹⁸]icosan]-16'-yl acetate |
Why not click here or view trends?
log id: 4033558