Wikidata entity: Q105208434
C₂₈H₃₆O₇ (P274)
Quantities
| P2067 | mass | 484.246103492 |
| P233 | canonical SMILES | String | O=C1OC(CC(=C1C)C)C2(OC(=O)C34CCC5C(CC6OC76C(O)CCC(=O)C57C)C4CCC23)C | ??? |
| P703 | found in taxon | ... | Q4674438 (Acnistus arborescens) | Acnistus arborescens |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC1=C(C)C(=O)O[C@@H]([C@]2(C)OC(=O)[C@]34CC[C@H]5[C@@H](C[C@H]6O[C@]67[C@@H](O)CCC(=O)[C@]57C)[C@@H]3CC[C@@H]42)C1 | ??? |
| P279 | subclass of | ... | Q105208435 (6-(4,5-Dimethyl-6-oxo-2,3-dihydropyran-2-yl)-17-hydroxy-6,13-dimethyl-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicosane-8,14-dione) | 6-(4,5-Dimethyl-6-oxo-2,3-dihydropyran-2-yl)-17-hydroxy-6,13-dimethyl-7,19-dioxahexacyclo[10.9.0.02,9.05,9.013,18.018,20]henicosane-8,14-dione |
Why not click here or view trends?
log id: 4715600