Wikidata entity: Q105245632
C₂₂H₃₀O₅ (P274)
Quantities
| P2067 | mass | 374.20932406 |
| P233 | canonical SMILES | String | O=C(OC1CC2C(C(=O)O)(C)CCCC2(C)C3CCC4C(=C)C(=O)C13C4)C | ??? |
| P703 | found in taxon | ... | Q2234889 (Xylopia) | Xylopia |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C=C1C(=O)[C@]23C[C@H]1CC[C@H]2[C@]1(C)CCC[C@@](C)(C(=O)O)[C@H]1C[C@@H]3OC(C)=O | ??? |
| P279 | subclass of | ... | Q108407223 (kaurane diterpenoid) | kaurane diterpenoid |
Why not click here or view trends?
log id: 4813010