Wikidata entity: Q105265758
Câ‚‚â‚„Hâ‚„â‚€ (P274)
Quantities
| P2067 | mass | 328.31300128 |
| P233 | canonical SMILES | String | C=CC(C)CCC(C(=CCC=C(C)C)C)CC=C(C)CCC=CC | ??? |
| P703 | found in taxon | ... | Q16034682 (Haslea ostrearia) | Haslea ostrearia |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C=C[C@H](C)CC[C@H](C/C=C(\C)CC/C=C/C)/C(C)=C/CC=C(C)C | ??? |
| P279 | subclass of | ... | Q105265757 (2,6,10-Trimethyl-7-(3-methylpent-4-enyl)pentadeca-2,5,9,13-tetraene) | 2,6,10-Trimethyl-7-(3-methylpent-4-enyl)pentadeca-2,5,9,13-tetraene |
Why not click here or view trends?
log id: 4718001