Wikidata entity: Q105276750
C₂₇H₄₄O₆ (P274)
Quantities
| P2067 | mass | 464.313789128 |
| P233 | canonical SMILES | String | O=C1C=C2C(CCC3(C)C(CCC23O)C(C)C(O)CCC(O)(C)C)C4(C)CC(O)C(O)CC14 | ??? |
| P703 | found in taxon | ... | Q17238408 (Silene praemixta) | Silene praemixta |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@H]([C@@H](O)CCC(C)(C)O)[C@H]1CC[C@@]2(O)C3=CC(=O)[C@@H]4C[C@@H](O)[C@@H](O)C[C@]4(C)[C@H]3CC[C@]12C | ??? |
| P3364 | stereoisomer of | ... | Q139085 (ecdysone) | ecdysone |
| P3364 | stereoisomer of | ... | Q27149575 (3-Epiecdysone) | 3-Epiecdysone |
| P3364 | stereoisomer of | ... | Q105276749 ((2S,3R,5R,9R,10R,13R,14S,17R)-17-[(2R,3R)-3,6-dihydroxy-6-methylheptan-2-yl]-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one) | (2S,3R,5R,9R,10R,13R,14S,17R)-17-[(2R,3R)-3,6-dihydroxy-6-methylheptan-2-yl]-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one |
| P279 | subclass of | ... | Q105276757 (2,3,14,22,25-Pentahydroxycholest-7-en-6-one) | 2,3,14,22,25-Pentahydroxycholest-7-en-6-one |
| P231 | CAS Registry Number | 7703-83-5 |
| P683 | ChEBI ID | 183026 |
| P3117 | DSSTox substance ID | DTXSID201316973 |
| P234 | InChI | InChI=1S/C27H44O6/c1-15(20(28)8-9-24(2,3)32)16-7-11-27(33)18-12-21(29)19-13-22(30)23(31)14-25(19,4)17(18)6-10-26(16,27)5/h12,15-17,19-20,22-23,28,30-33H,6-11,13-14H2,1-5H3/t15-,16+,17-,19-,20-,22+,23-,25+,26+,27+/m0/s1 |
| P235 | InChIKey | UPEZCKBFRMILAV-IOOUKINDSA-N |
| P2063 | LIPID MAPS ID | LMST01010361 |
| P662 | PubChem CID | 56940692 |
| P2877 | SureChEMBL ID | 26642138 |
| P11089 | UniChem compound ID | 27141201 |
Why not click here or view trends?
log id: 5607130