Wikidata entity: Q105293175
C₂₀H₃₀O₇ (P274)
Quantities
| P2067 | mass | 382.1991533 |
| P233 | canonical SMILES | String | O=C1OC2C(C1=C)C(OC(=O)C(O)(C)C(O)C)CC3(C)C(O)CCC(C)C23 | ??? |
| P703 | found in taxon | ... | Q2176037 (Tithonia rotundifolia) | Tithonia rotundifolia |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C=C1C(=O)O[C@H]2[C@H]3[C@@H](C)CC[C@@H](O)[C@@]3(C)C[C@@H](OC(=O)[C@](C)(O)[C@@H](C)O)[C@@H]12 | ??? |
| P279 | subclass of | ... | Q105293176 (Tirotundifolin E) | Tirotundifolin E |
Why not click here or view trends?
log id: 4506255