Wikidata entity: Q105331374
C₆₀H₈₆N₄O₂₂ (P274)
Quantities
| P2067 | mass | 1214.573370392 |
| P233 | canonical SMILES | String | O=C(O)CCC(=O)OC1C(OC(OC2C(OC(OC3C(OC(OC4C(N(C)C)C(O)C5OC6=C7C(=O)C=8C(O)=C9C(=C(O)C8C(=O)C7=CC=C6C4(O5)C)C(OC%10OC(C)C(O)C(N(C)C)C%10)CC(O)(C)C9)CC3(N)C)C)CC2(N)C)C)CC1OC)C | ??? |
| P703 | found in taxon | ... | Q21319425 (Streptomyces avidinii) | Streptomyces avidinii |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CO[C@@H]1C[C@@H](O[C@H]2[C@@H](C)O[C@@H](O[C@H]3[C@@H](C)O[C@@H](O[C@@H]4[C@@H](N(C)C)[C@@H](O)[C@H]5Oc6c(ccc7c6C(=O)c6c(O)c8c(c(O)c6C7=O)[C@@H](O[C@H]6C[C@@H](N(C)C)[C@H](O)[C@@H](C)O6)C[C@](C)(O)C8)[C@]4(C)O5)C[C@]3(C)N)C[C@]2(C)N)O[C@@H](C)[C@H]1OC(=O)CCC(=O)O | ??? |
| P279 | subclass of | ... | Q109603820 (anthracycline polyketide) | anthracycline polyketide |
Why not click here or view trends?
log id: 3681436