Wikidata entity: Q105348791
C₃₂H₅₄ (P274)
Quantities
| P2067 | mass | 438.422551728 |
| P233 | canonical SMILES | String | C=CC(C=CC(C)CCC=C(C)CCC(C(=C)C)C)(C)CCC=C(C)CCC(C(=C)C)C | ??? |
| P703 | found in taxon | ... | Q149449 (Botryococcus braunii) | Botryococcus braunii |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C=C[C@@](C)(/C=C/[C@@H](C)CC/C=C(\C)CC[C@@H](C)C(=C)C)CC/C=C(\C)CC[C@@H](C)C(=C)C | ??? |
| P279 | subclass of | ... | Q105348792 (10-Ethenyl-2,3,6,10,13,17,20,21-octamethyldocosa-1,6,11,16,21-pentaene) | 10-Ethenyl-2,3,6,10,13,17,20,21-octamethyldocosa-1,6,11,16,21-pentaene |
Why not click here or view trends?
log id: 4852237