Wikidata entity: Q106041750
C₉H₁₄N₄O₄ (P274)
Quantities
| P2067 | mass | 242.101504928 |
| P233 | canonical SMILES | String | CCOC(=O)N=c1c[n+](N2CCOCC2)[n-]o1 | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 25717-80-0 |
| P683 | ChEBI ID | 31861 |
| P683 | ChEBI ID | 92623 |
| P715 | DrugBank ID | DB09282 |
| P3117 | DSSTox substance ID | DTXSID0045171 |
| P2057 | Human Metabolome Database ID | HMDB0245703 |
| P234 | InChI | InChI=1S/C9H14N4O4/c1-2-16-9(14)10-8-7-13(11-17-8)12-3-5-15-6-4-12/h7H,2-6H2,1H3 |
| P235 | InChIKey | XLFWDASMENKTKL-UHFFFAOYSA-N |
| P11199 | Probes And Drugs ID | PD001642 |
| P662 | PubChem CID | 4238 |
| P662 | PubChem CID | 5353788 |
| P662 | PubChem CID | 5360788 |
| P2877 | SureChEMBL ID | 34020 |
| P2877 | SureChEMBL ID | 34019 |
| P2877 | SureChEMBL ID | 612914 |
| P652 | UNII | D46583G77X |
Why not click here or view trends?
log id: 5399707