Abstract is: 4-Chloro-4-deoxygalactose (chlorodeoxygalactose) is chlorinated derivative of the sugar galactose. It is one of the two components comprising the disaccharide sucralose, a commercial sugar substitute. It is a hydrolysis product when sucralose is degraded.
P233 | canonical SMILES | C(C(C(C(C(C=O)O)O)Cl)O)O |
P231 | CAS Registry Number | 61489-30-3 |
P661 | ChemSpider ID | 21376527 |
P234 | InChI | InChI=1S/C6H11ClO5/c7-5(3(10)1-8)6(12)4(11)2-9/h2-6,8,10-12H,1H2/t3-,4+,5+,6-/m1/s1 |
P235 | InChIKey | KWXIWFADURXYFY-DPYQTVNSSA-N |
P2017 | isomeric SMILES | C([C@H]([C@@H]([C@@H]([C@H](C=O)O)O)Cl)O)O |
P662 | PubChem CID | 87593241 |
P11089 | UniChem compound ID | 79197214 |
P2067 | mass | 198.029501132 |
Q36281169 | Synthesis of 4” manipulated Lewis X trisaccharide analogues | main subject | P921 |