Abstract is: Isobutyl cyanoacrylate is an isomer of butyl cyanoacrylate. It is used in medical procedures either to close incisions and lacerations without the use of sutures, or as an adjunct to strengthen the suturing. This use is possible because it is a bactericidal liquid monomer which, in thepresence of small amounts of moisture, rapidly polymerizes to form a strong adhesive.
| P7049 | AICS Chemical ID (BEING DELETED) | 1488 |
| P233 | canonical SMILES | CC(C)COC(=O)C(=C)C#N |
| P231 | CAS Registry Number | 1069-55-2 |
| P592 | ChEMBL ID | CHEMBL2103950 |
| P661 | ChemSpider ID | 13427 |
| P8494 | DSSTOX compound identifier | DTXCID6033031 |
| P3117 | DSSTox substance ID | DTXSID1061447 |
| P232 | EC number | 213-958-1 |
| P2566 | ECHA Substance Infocard ID | 100.012.690 |
| P646 | Freebase ID | /m/0czbhdf |
| P2057 | Human Metabolome Database ID | HMDB0249423 |
| P234 | InChI | InChI=1S/C8H11NO2/c1-6(2)5-11-8(10)7(3)4-9/h6H,3,5H2,1-2H3 |
| P235 | InChIKey | QRWOVIRDHQJFDB-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | D002015 |
| P672 | MeSH tree code | D02.241.081.069.366.200 |
| D02.626.290.200 | ||
| D05.750.259.341.110 | ||
| D25.720.259.341.110 | ||
| D25.919.367.341.110 | ||
| J01.637.051.720.259.341.110 | ||
| J01.637.051.919.367.341.110 | ||
| P6366 | Microsoft Academic ID | 2781139222 |
| P11199 | Probes And Drugs ID | PD075760 |
| P662 | PubChem CID | 14046 |
| P2877 | SureChEMBL ID | SCHEMBL168360 |
| P2892 | UMLS CUI | C0006341 |
| P11089 | UniChem compound ID | 25405649 |
| P652 | UNII | 2HJV1F859Z |
| P1889 | different from | butyl cyanoacrylate | Q5003173 |
| P2067 | mass | 153.079 | |
| P2868 | subject has role | tissue adhesive | Q50430178 |