Wikidata entity: Q1101193
C₂D₆O (P274)

Quantities
| P2067 | mass | 52.079525 |
| P233 | canonical SMILES | String | CCO | ??? |
| P373 | Commons category | String | Deuterated ethanol | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | [2H]C([2H])([2H])C([2H])([2H])O[2H] | ??? |
| P9977 | isotopically modified form of | ... | Q153 (ethanol) | ethanol |
| P279 | subclass of | ... | Q43993964 (deuterated compound) | deuterated compound |
| P231 | CAS Registry Number | 1516-08-1 |
| P683 | ChEBI ID | 193043 |
| P661 | ChemSpider ID | 92272 |
| P8494 | DSSTOX compound identifier | DTXCID801362950 |
| P3117 | DSSTox substance ID | DTXSID80934298 |
| P232 | EC number | 216-162-2 |
| P2566 | ECHA Substance Infocard ID | 100.014.693 |
| P646 | Freebase ID | /m/0282ry_ |
| P234 | InChI | InChI=1S/C2H6O/c1-2-3/h3H,2H2,1H3/i1D3,2D2,3D |
| P235 | InChIKey | LFQSCWFLJHTTHZ-LIDOUZCJSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2778213804 |
| P662 | PubChem CID | 102138 |
| P2877 | SureChEMBL ID | 4169894 |
| P11089 | UniChem compound ID | 22663785 |
Why not click here or view trends?
log id: 7660412