Wikidata entity: Q1130256
C₆H₁₀N₄O₂ (P274)
Quantities
| P2067 | mass | 170.08 |
| P233 | canonical SMILES | String | C1COCCN1[N+]2=CC(=N)O[N-]2 | ??? |
| P373 | Commons category | String | Linsidomine | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q50316227 (nitric oxide donors) | nitric oxide donors |
| P2868 | subject has role | ... | Q575890 (antihypertensive drug) | antihypertensive drug |
| P2868 | subject has role | ... | Q721432 (platelet aggregation inhibitors) | platelet aggregation inhibitors |
| P2868 | subject has role | ... | Q4008956 (vasodilator agent) | vasodilator agent |
| P2868 | subject has role | ... | Q427492 (enzyme inhibitor) | enzyme inhibitor |
| P267 | ATC code | C01DX18 |
| P231 | CAS Registry Number | 33876-97-0 |
| P683 | ChEBI ID | 136004 |
| P592 | ChEMBL ID | CHEMBL1189150 |
| P661 | ChemSpider ID | 10561427 |
| P715 | DrugBank ID | DB13400 |
| P11198 | DrugCentral ID | 4589 |
| P3117 | DSSTox substance ID | DTXSID501026026 |
| P646 | Freebase ID | /m/03yns26 |
| P2057 | Human Metabolome Database ID | HMDB0254106 |
| P234 | InChI | InChI=1S/C6H10N4O2/c7-6-5-10(8-12-6)9-1-3-11-4-2-9/h5,7H,1-4H2 |
| P235 | InChIKey | FKDHHVKWGRFRTG-UHFFFAOYSA-N |
| P665 | KEGG ID | D07161 |
| P486 | MeSH descriptor ID | C002385 |
| P6366 | Microsoft Academic ID (discontinued) | 2780821149 |
| P11199 | Probes And Drugs ID | PD071995 |
| P662 | PubChem CID | 5219 |
| P2877 | SureChEMBL ID | 160502 |
| P2892 | UMLS CUI | C2718070 |
| P11089 | UniChem compound ID | 357604 |
| P652 | UNII | 5O5U71P6VQ |
Why not click here or view trends?
log id: 5457538