Wikidata entity: Q12127712
C₁₄H₁₅N₃O₆S (P274)
Quantities
| P2067 | mass | 353.068 |
| P233 | canonical SMILES | String | CC1=CN(C(=O)N(C1=O)CC2=C(SC=C2)C(=O)O)CC(C(=O)O)N | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CC1=CN(C(=O)N(C1=O)CC2=C(SC=C2)C(=O)O)C[C@@H](C(=O)O)N | ??? |
| P129 | physically interacts with | ... | Q21108701 (Glutamate ionotropic receptor kainate type subunit 1) | Glutamate ionotropic receptor kainate type subunit 1 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P683 | ChEBI ID | 46276 |
| P592 | ChEMBL ID | CHEMBL373428 |
| P661 | ChemSpider ID | 4925719 |
| P2671 | Google Knowledge Graph ID | /g/1219bm_f |
| P595 | Guide to Pharmacology Ligand ID | 4092 |
| P595 | Guide to Pharmacology Ligand ID | 4334 |
| P234 | InChI | InChI=1S/C14H15N3O6S/c1-7-4-16(6-9(15)12(19)20)14(23)17(11(7)18)5-8-2-3-24-10(8)13(21)22/h2-4,9H,5-6,15H2,1H3,(H,19,20)(H,21,22)/t9-/m0/s1 |
| P235 | InChIKey | ZTAZUCRXCRXNSU-VIFPVBQESA-N |
| P3636 | PDB ligand ID | UBA |
| P638 | PDB structure ID | 2OJT |
| P638 | PDB structure ID | 2F34 |
| P11199 | Probes And Drugs ID | PD038430 |
| P662 | PubChem CID | 6420160 |
| P2877 | SureChEMBL ID | 15959446 |
| P11089 | UniChem compound ID | 312857 |
Why not click here or view trends?
log id: 2155953