Wikidata entity: Q12200764
C₂₅H₂₃ClN₂O₇ (P274)
Quantities
| P2067 | mass | 498.119 |
| P233 | canonical SMILES | String | CC(C)(C(=O)OC(COC(=O)C1=CN=CC=C1)COC(=O)C2=CN=CC=C2)OC3=CC=C(C=C3)Cl | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q18554145 (familial hyperlipidemia) | familial hyperlipidemia |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q955332 (hypolipidemic) | hypolipidemic |
| P231 | CAS Registry Number | 69047-39-8 |
| P683 | ChEBI ID | 135800 |
| P592 | ChEMBL ID | CHEMBL2106582 |
| P661 | ChemSpider ID | 62116 |
| P11198 | DrugCentral ID | 372 |
| P8494 | DSSTOX compound identifier | DTXCID00141604 |
| P3117 | DSSTox substance ID | DTXSID80219113 |
| P2671 | Google Knowledge Graph ID | /g/121vf2nf |
| P234 | InChI | InChI=1S/C25H23ClN2O7/c1-25(2,35-20-9-7-19(26)8-10-20)24(31)34-21(15-32-22(29)17-5-3-11-27-13-17)16-33-23(30)18-6-4-12-28-14-18/h3-14,21H,15-16H2,1-2H3 |
| P235 | InChIKey | BFYRHDVAEJIBON-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C038877 |
| P11199 | Probes And Drugs ID | PD072230 |
| P662 | PubChem CID | 68884 |
| P2877 | SureChEMBL ID | 49116 |
| P11089 | UniChem compound ID | 1074807 |
| P652 | UNII | 9NGZ4GPE20 |
Why not click here or view trends?
log id: 1986780