Wikidata entity: Q12430647
C₂₀H₃₀ClN₃O₂ (P274)
Quantities
| P2067 | mass | 379.202655 |
| P233 | canonical SMILES | String | CCCCOC1=NC2=CC=CC=C2C(=C1)C(=O)NCCN(CC)CC.Cl | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q3459294 (Sodium voltage-gated channel alpha subunit 5) | Sodium voltage-gated channel alpha subunit 5 |
| P129 | physically interacts with | ... | Q21126334 (Sodium voltage-gated channel alpha subunit 10) | Sodium voltage-gated channel alpha subunit 10 |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 61-12-1 |
| P683 | ChEBI ID | 59735 |
| P592 | ChEMBL ID | CHEMBL1200612 |
| P661 | ChemSpider ID | 5853 |
| P715 | DrugBank ID | DBSALT000639 |
| P8494 | DSSTOX compound identifier | DTXCID001403845 |
| P3117 | DSSTox substance ID | DTXSID80976471 |
| P232 | EC number | 200-498-1 |
| P2566 | ECHA Substance Infocard ID | 100.000.453 |
| P2671 | Google Knowledge Graph ID | /g/122x83x4 |
| P234 | InChI | InChI=1S/C20H29N3O2.ClH/c1-4-7-14-25-19-15-17(16-10-8-9-11-18(16)22-19)20(24)21-12-13-23(5-2)6-3;/h8-11,15H,4-7,12-14H2,1-3H3,(H,21,24);1H |
| P235 | InChIKey | IVHBBMHQKZBJEU-UHFFFAOYSA-N |
| P665 | KEGG ID | D02220 |
| P2840 | NSC number | 756724 |
| P11199 | Probes And Drugs ID | PD002383 |
| P662 | PubChem CID | 6078 |
| P662 | PubChem CID | 521951 |
| P662 | PubChem CID | 657388 |
| P1579 | Reaxys registry number | 3770332 |
| P3345 | RxNorm CUI | 235402 |
| P4964 | SPLASH | splash10-00xu-0295000000-badcd638c9c1e6573c73 |
| P2877 | SureChEMBL ID | 31303 |
| P2877 | SureChEMBL ID | 31304 |
| P652 | UNII | Z97702A5DG |
Why not click here or view trends?
log id: 3616687