Wikidata entity: Q127900
C₁₂H₂₂O₁₁ (P274)
Quantities
| P2067 | mass | 342.116 |
| P233 | canonical SMILES | String | C(C1C(C(C(C(O1)OC2C(OC(C(C2O)O)O)CO)O)O)O)O | ??? |
| P373 | Commons category | String | Lactose | ??? |
| P935 | Commons gallery | String | Lactose | ??? |
| P1343 | described by source | ... | Q19190511 (New Encyclopedic Dictionary) | New Encyclopedic Dictionary |
| P1343 | described by source | ... | Q20078554 (Great Soviet Encyclopedia (1926–1947)) | Great Soviet Encyclopedia (1926–1947) |
| P1343 | described by source | ... | Q124737630 (Armenian Soviet Encyclopedia, vol. 4) | Armenian Soviet Encyclopedia, vol. 4 |
| P703 | found in taxon | ... | Q158289 (Hypericum perforatum) | Hypericum perforatum |
| P527 | has part(s) | ... | Q556 (hydrogen) | hydrogen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P366 | has use | ... | Q26883713 (Milk sugar and syrups) | Milk sugar and syrups |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P31 | instance of | ... | Q136192523 (simple carbohydrates) | simple carbohydrates |
| P2017 | isomeric SMILES | String | C([C@@H]1[C@@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](O[C@H]([C@@H]([C@H]2O)O)O)CO)O)O)O)O | ??? |
| P5008 | on focus list of Wikimedia project | ... | Q6173448 (Wikipedia:Vital articles/Level/4) | Wikipedia:Vital articles/Level/4 |
| P443 | pronunciation audio | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/LL-Q8752%20%28eus%29-Xabier%20Ca%C3%B1as-Laktosa.wav | ??? |
| P443 | pronunciation audio | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Nl-lactose.ogg | ??? |
| P443 | pronunciation audio | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Pl-laktoza.ogg | ??? |
| P443 | pronunciation audio | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Sv-laktos.ogg | ??? |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P3364 | stereoisomer of | ... | Q115784681 (L-Gul(a1-4)b-Tal) | L-Gul(a1-4)b-Tal |
| P3364 | stereoisomer of | ... | Q26914016 (α-maltose) | α-maltose |
| P3364 | stereoisomer of | ... | Q26914030 (β-maltose) | β-maltose |
| P3364 | stereoisomer of | ... | Q27092863 (beta-Mannobiose) | beta-Mannobiose |
| P3364 | stereoisomer of | ... | Q27093692 (Galactobiose) | Galactobiose |
| P3364 | stereoisomer of | ... | Q27103831 (alpha-cellobiose) | alpha-cellobiose |
| P3364 | stereoisomer of | ... | Q27104340 (beta-cellobiose) | beta-cellobiose |
| P3364 | stereoisomer of | ... | Q27104342 (α-lactose) | α-lactose |
| P3364 | stereoisomer of | ... | Q27106310 (β-D-glucosyl-(1→4)-β-D-mannose) | β-D-glucosyl-(1→4)-β-D-mannose |
| P3364 | stereoisomer of | ... | Q27116750 (alpha-mannobiose) | alpha-mannobiose |
| P3364 | stereoisomer of | ... | Q27116753 (β-D-galactopyranosyl-(1→4)-α-D-galactopyranose) | β-D-galactopyranosyl-(1→4)-α-D-galactopyranose |
| P3364 | stereoisomer of | ... | Q27120859 (β-D-glucosyl-(1→4)-α-D-mannose) | β-D-glucosyl-(1→4)-α-D-mannose |
| P3364 | stereoisomer of | ... | Q27120862 (α-D-glucosyl-(1→4)-β-D-mannose) | α-D-glucosyl-(1→4)-β-D-mannose |
| P3364 | stereoisomer of | ... | Q27120863 (α-D-glucosyl-(1→4)-α-D-mannose) | α-D-glucosyl-(1→4)-α-D-mannose |
| P3364 | stereoisomer of | ... | Q27126621 (α-D-Galp-(1→4)-β-D-Galp) | α-D-Galp-(1→4)-β-D-Galp |
| P3364 | stereoisomer of | ... | Q27159442 (β-D-Gal-(1→4)-α-D-Man) | β-D-Gal-(1→4)-α-D-Man |
| P3364 | stereoisomer of | ... | Q104249380 (Gal(a1-4)a-Ido) | Gal(a1-4)a-Ido |
| P3364 | stereoisomer of | ... | Q105019934 (β-D-mannopyranosyl-(1→4)-β-D-glucopyranose) | β-D-mannopyranosyl-(1→4)-β-D-glucopyranose |
| P3364 | stereoisomer of | ... | Q105019946 (Gal(a1-4)a-Alt) | Gal(a1-4)a-Alt |
| P3364 | stereoisomer of | ... | Q106046222 (beta-epilactose) | beta-epilactose |
| P3364 | stereoisomer of | ... | Q106054206 (α-D-Galp-(1→4)-α-D-Glcp) | α-D-Galp-(1→4)-α-D-Glcp |
| P3364 | stereoisomer of | ... | Q106054211 (α-D-Galp-(1→4)-β-D-Glcp) | α-D-Galp-(1→4)-β-D-Glcp |
| P3364 | stereoisomer of | ... | Q106054383 (α-D-Galp-(1→4)-α-D-Galp) | α-D-Galp-(1→4)-α-D-Galp |
| P3364 | stereoisomer of | ... | Q106054450 (α-D-Glcp-(1→4)-β-D-Galp) | α-D-Glcp-(1→4)-β-D-Galp |
| P3364 | stereoisomer of | ... | Q106054454 (α-D-Glcp-(1→4)-α-D-Galp) | α-D-Glcp-(1→4)-α-D-Galp |
| P3364 | stereoisomer of | ... | Q106054525 (β-D-Glcp-(1→4)-β-D-Galp) | β-D-Glcp-(1→4)-β-D-Galp |
| P3364 | stereoisomer of | ... | Q106054531 (β-D-Glcp-(1→4)-α-D-Galp) | β-D-Glcp-(1→4)-α-D-Galp |
| P3364 | stereoisomer of | ... | Q106054587 (α-D-Manp-(1→4)-α-D-Manp) | α-D-Manp-(1→4)-α-D-Manp |
| P3364 | stereoisomer of | ... | Q106054642 (α-D-Manp-(1→4)-β-D-Manp) | α-D-Manp-(1→4)-β-D-Manp |
| P3364 | stereoisomer of | ... | Q106055780 (β-D-Manp-(1→4)-β-Galp) | β-D-Manp-(1→4)-β-Galp |
| P279 | subclass of | ... | Q56229948 (α/β-lactose) | α/β-lactose |
| P2868 | subject has role | ... | Q902638 (excipient) | excipient |
| P7033 | Australian Educational Vocabulary ID | scot/11129 |
| P2581 | BabelNet ID | 00049649n |
| P2581 | BabelNet ID | 00049649n |
| P268 | Bibliothèque nationale de France ID | 11965329v |
| P508 | BNCF Thesaurus ID | 25189 |
| P5019 | Brockhaus Enzyklopädie online ID | lactobiose |
| P231 | CAS Registry Number | 63-42-3 |
| P683 | ChEBI ID | 36218 |
| P592 | ChEMBL ID | CHEMBL417016 |
| P661 | ChemSpider ID | 5904 |
| P1036 | Dewey Decimal Classification | 547.78 |
| P1036 | Dewey Decimal Classification | 572.565 |
| P1036 | Dewey Decimal Classification | 612.01578 |
| P8494 | DSSTOX compound identifier | DTXCID403193 |
| P3117 | DSSTox substance ID | DTXSID2023193 |
| P232 | EC number | 200-559-2 |
| P2566 | ECHA Substance Infocard ID | 100.000.509 |
| P10565 | Encyclopedia of China (Third Edition) ID | 187148 |
| P1417 | Encyclopædia Britannica Online ID | science/lactose |
| P5437 | EuroVoc ID | 1563 |
| P646 | Freebase ID | /m/04qlf |
| P1578 | Gmelin number | 342369 |
| P227 | GND ID | 4166380-9 |
| P7502 | Golden ID | Lactose-YAE3 |
| P12385 | Gran Enciclopèdia Catalana ID | lactosa |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0118746 |
| P2924 | Great Russian Encyclopedia Online ID (old version) | 2641666 |
| P2062 | HSDB ID | 7962 |
| P2057 | Human Metabolome Database ID | HMDB0041627 |
| P4168 | IEDB Epitope ID | 423147 |
| P234 | InChI | InChI=1S/C12H22O11/c13-1-3-5(15)6(16)9(19)12(22-3)23-10-4(2-14)21-11(20)8(18)7(10)17/h3-20H,1-2H2/t3-,4-,5+,6+,7-,8-,9-,10-,11-,12+/m1/s1 |
| P235 | InChIKey | GUBGYTABKSRVRQ-DCSYEGIMSA-N |
| P8408 | KBpedia ID | Lactose |
| P665 | KEGG ID | C01970 |
| P8313 | Lex ID | laktose |
| P244 | Library of Congress authority ID | sh85073871 |
| P6689 | MassBank accession ID | MSBNK-MPI_for_Chemical_Ecology-CE000692 |
| P6689 | MassBank accession ID | MSBNK-Osaka_Univ-OUF00296 |
| P6689 | MassBank accession ID | MSBNK-Osaka_Univ-OUF00297 |
| P6366 | Microsoft Academic ID (discontinued) | 2778724459 |
| P12596 | museum-digital tag ID | 19659 |
| P12596 | museum-digital tag ID | 96911 |
| P2004 | NALT ID | 33970 |
| P8189 | National Library of Israel J9U ID | 987007550695305171 |
| P950 | National Library of Spain SpMaBN ID (BNE v1.0) | XX535524 |
| P349 | NDL Authority ID | 00568767 |
| P691 | NL CR AUT ID | ph505549 |
| P1245 | OmegaWiki Defined Meaning | 938146 |
| P10283 | OpenAlex ID | C2778724459 |
| P3636 | PDB ligand ID | LAT |
| P638 | PDB structure ID | 3NBC |
| P638 | PDB structure ID | 1GWV |
| P638 | PDB structure ID | 4ZLB |
| P638 | PDB structure ID | 4R9A |
| P638 | PDB structure ID | 3WG1 |
| P638 | PDB structure ID | 3NJS |
| P638 | PDB structure ID | 4R9D |
| P638 | PDB structure ID | 3ZSJ |
| P638 | PDB structure ID | 2IY8 |
| P638 | PDB structure ID | 1O7O |
| P638 | PDB structure ID | 1GZ9 |
| P638 | PDB structure ID | 1IS4 |
| P638 | PDB structure ID | 1IS3 |
| P638 | PDB structure ID | 1V00 |
| P638 | PDB structure ID | 4IZX |
| P638 | PDB structure ID | 2Y9G |
| P638 | PDB structure ID | 2ZGM |
| P638 | PDB structure ID | 1MS0 |
| P638 | PDB structure ID | 1GZC |
| P638 | PDB structure ID | 1SFY |
| P638 | PDB structure ID | 4YLZ |
| P638 | PDB structure ID | 4BMB |
| P638 | PDB structure ID | 3AYE |
| P638 | PDB structure ID | 3M2M |
| P638 | PDB structure ID | 5CBL |
| P638 | PDB structure ID | 4YM0 |
| P638 | PDB structure ID | 1JYN |
| P638 | PDB structure ID | 3CA4 |
| P638 | PDB structure ID | 4A3X |
| P638 | PDB structure ID | 1W6O |
| P638 | PDB structure ID | 2PEL |
| P638 | PDB structure ID | 4RL7 |
| P638 | PDB structure ID | 2ZGO |
| P638 | PDB structure ID | 4YM1 |
| P638 | PDB structure ID | 2YMZ |
| P638 | PDB structure ID | 1KNM |
| P638 | PDB structure ID | 1PUU |
| P638 | PDB structure ID | 1DLL |
| P638 | PDB structure ID | 4D5O |
| P638 | PDB structure ID | 1SX6 |
| P638 | PDB structure ID | 1SE4 |
| P638 | PDB structure ID | 4COU |
| P638 | PDB structure ID | 1RIT |
| P638 | PDB structure ID | 4YM3 |
| P638 | PDB structure ID | 1VZU |
| P638 | PDB structure ID | 5DUV |
| P638 | PDB structure ID | 4I4S |
| P638 | PDB structure ID | 1Z3V |
| P638 | PDB structure ID | 4YM2 |
| P638 | PDB structure ID | 4CP0 |
| P638 | PDB structure ID | 4R9B |
| P638 | PDB structure ID | 4R9C |
| P638 | PDB structure ID | 5E1Q |
| P638 | PDB structure ID | 2EVD |
| P638 | PDB structure ID | 3AP6 |
| P638 | PDB structure ID | 2YXS |
| P638 | PDB structure ID | 4NO4 |
| P638 | PDB structure ID | 1MS9 |
| P638 | PDB structure ID | 3LSE |
| P638 | PDB structure ID | 4HOA |
| P638 | PDB structure ID | 1IT0 |
| P638 | PDB structure ID | 3AP7 |
| P638 | PDB structure ID | 2EUM |
| P638 | PDB structure ID | 2NN8 |
| P638 | PDB structure ID | 4F8O |
| P638 | PDB structure ID | 5DUX |
| P638 | PDB structure ID | 3VT0 |
| P10890 | PM20 ware ID | 143577 |
| P1051 | PSH ID | 6148 |
| P662 | PubChem CID | 6134 |
| P3417 | Quora topic ID | Lactose |
| P1579 | Reaxys registry number | 90841 |
| P10376 | ScienceDirect topic ID | agricultural-and-biological-sciences/lactose |
| P10376 | ScienceDirect topic ID | biochemistry-genetics-and-molecular-biology/lactose |
| P10376 | ScienceDirect topic ID | chemistry/lactose |
| P10376 | ScienceDirect topic ID | earth-and-planetary-sciences/lactose |
| P10376 | ScienceDirect topic ID | food-science/lactose |
| P10376 | ScienceDirect topic ID | medicine-and-dentistry/lactose |
| P10376 | ScienceDirect topic ID | neuroscience/lactose |
| P10376 | ScienceDirect topic ID | nursing-and-health-professions/lactose |
| P10376 | ScienceDirect topic ID | pharmacology-toxicology-and-pharmaceutical-science/lactose |
| P4964 | SPLASH | splash10-0gb9-1983000000-e184694c56f5ca3eaf44 |
| P4964 | SPLASH | splash10-0uxr-1983000000-6d13b583508b156699cb |
| P5082 | Store medisinske leksikon ID | laktose |
| P2877 | SureChEMBL ID | 782 |
| P3365 | Treccani ID | lattosio |
| P11089 | UniChem compound ID | 637051 |
| P652 | UNII | 13Q3A43E0S |
| P12800 | Vikidia article ID | fr:Lactose |
| P12086 | WikiKids ID | Lactose |
| P3471 | WikiSkripta article ID | 15011 |
| P8814 | WordNet 3.1 Synset ID | 14953600-n |
| P13591 | Yale LUX ID | concept/c23dd21e-a54d-4d38-b79c-cb90e0a372ea |
| P2347 | YSO ID | 16710 |
| P3553 | Zhihu topic ID | 19676284 |
| P679 | ZVG number | 100321 |
Why not click here or view trends?
log id: 2854611