Wikidata entity: Q138145
C₆H₁₅O₁₅P₃ (P274)
Quantities
| P2067 | mass | 419.96238 |
| P233 | canonical SMILES | String | C1(C(C(C(C(C1OP(=O)(O)O)O)OP(=O)(O)O)OP(=O)(O)O)O)O | ??? |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | [C@@H]1([C@H]([C@@H]([C@H]([C@@H]([C@H]1OP(=O)(O)O)O)OP(=O)(O)O)OP(=O)(O)O)O)O | ??? |
| P3364 | stereoisomer of | ... | Q26998374 (IP3) | IP3 |
| P3364 | stereoisomer of | ... | Q27092892 ((1s,3s,4s)-1,3,4-Triphospho-Myo-Inositol) | (1s,3s,4s)-1,3,4-Triphospho-Myo-Inositol |
| P3364 | stereoisomer of | ... | Q27096381 (D-Myo-Inositol-1,2,4-Triphosphate) | D-Myo-Inositol-1,2,4-Triphosphate |
| P3364 | stereoisomer of | ... | Q27132279 (1D-myo-inositol 3,4,6-trisphosphate) | 1D-myo-inositol 3,4,6-trisphosphate |
| P3364 | stereoisomer of | ... | Q27461316 (D-myo-inositol-2,4,5-triphosphate) | D-myo-inositol-2,4,5-triphosphate |
| P3364 | stereoisomer of | ... | Q33129821 (inositol 1,3,4-trisphosphate) | inositol 1,3,4-trisphosphate |
| P3364 | stereoisomer of | ... | Q105168148 ([(1S,2S,3R,4R,5R,6R)-2,3,5-trihydroxy-4,6-diphosphonooxycyclohexyl] dihydrogen phosphate) | [(1S,2S,3R,4R,5R,6R)-2,3,5-trihydroxy-4,6-diphosphonooxycyclohexyl] dihydrogen phosphate |
| P279 | subclass of | ... | Q110080224 (inositol 1,4,5-trisphosphate) | inositol 1,4,5-trisphosphate |
| P231 | CAS Registry Number | 2068-89-5 |
| P231 | CAS Registry Number | 88269-39-0 |
| P683 | ChEBI ID | 191121 |
| P661 | ChemSpider ID | 49951 |
| P8494 | DSSTOX compound identifier | DTXCID101323791 |
| P10565 | Encyclopedia of China (Third Edition) ID | 129559 |
| P646 | Freebase ID | /m/0dlyj |
| P234 | InChI | InChI=1S/C6H15O15P3/c7-1-2(8)5(20-23(13,14)15)6(21-24(16,17)18)3(9)4(1)19-22(10,11)12/h1-9H,(H2,10,11,12)(H2,13,14,15)(H2,16,17,18)/t1-,2+,3+,4-,5-,6-/m0/s1 |
| P235 | InChIKey | MMWCIQZXVOZEGG-HOZKJCLWSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2781387506 |
| P10283 | OpenAlex ID | C2781387506 |
| P662 | PubChem CID | 55310 |
| P5082 | Store medisinske leksikon ID | inositoltrifosfat |
| P2877 | SureChEMBL ID | 381458 |
| P11089 | UniChem compound ID | 24947749 |
Why not click here or view trends?
log id: 3715443