Wikidata entity: Q139199
C₆H₁₅N (P274)
Quantities
| P2102 | boiling point | 193 |
| P2054 | density | 0.73 |
| P2128 | flash point | 20 |
| P2129 | immediately dangerous to life or health | 828 |
| P2260 | ionization energy | 7.5 |
| P2202 | lower flammable limit | 1.2 |
| P2067 | mass | 101.12 |
| P2101 | melting point | -175 |
| P2101 | melting point | -114.99999999999997 |
| P1117 | pKa | 10.65 |
| P2177 | solubility | 2 |
| P2404 | time-weighted average exposure limit | 100 |
| P2203 | upper flammable limit | 8 |
| P2119 | vapor pressure | 54 |
| P3335 | associated hazard | ... | Q21175388 (triethylamine exposure) | triethylamine exposure |
| P233 | canonical SMILES | String | CCN(CC)CC | ??? |
| P373 | Commons category | String | Triethylamine | ??? |
| P703 | found in taxon | ... | Q4996000 (Bulbophyllum variegatum) | Bulbophyllum variegatum |
| P1552 | has characteristic | ... | Q21009055 (Class IB flammable liquid) | Class IB flammable liquid |
| P1542 | has effect | ... | Q21175388 (triethylamine exposure) | triethylamine exposure |
| P527 | has part(s) | ... | Q556 (hydrogen) | hydrogen |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Triethylamine-3D-balls.png | ??? |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Triethylamine-3D-vdW.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P1987 | MCN code | String | 2921.19.12 | ??? |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P8072 | CAB ID | 278239 |
| P11931 | CAMEO Chemicals ID | 4691 |
| P231 | CAS Registry Number | 121-44-8 |
| P683 | ChEBI ID | 35026 |
| P592 | ChEMBL ID | CHEMBL284057 |
| P661 | ChemSpider ID | 8158 |
| P3073 | CosIng number | 94127 |
| P8494 | DSSTOX compound identifier | DTXCID204366 |
| P3117 | DSSTox substance ID | DTXSID301024181 |
| P3117 | DSSTox substance ID | DTXSID3024366 |
| P232 | EC number | 204-469-4 |
| P2566 | ECHA Substance Infocard ID | 100.004.064 |
| P10565 | Encyclopedia of China (Third Edition) ID | 157051 |
| P9066 | FL number | 11.023 |
| P646 | Freebase ID | /m/05yh_1 |
| P1578 | Gmelin number | 2455 |
| P227 | GND ID | 4331428-4 |
| P7025 | HCIS ID | 4580 |
| P2062 | HSDB ID | 896 |
| P2057 | Human Metabolome Database ID | HMDB0032539 |
| P5220 | ICSC ID | 0203 |
| P234 | InChI | InChI=1S/C6H15N/c1-4-7(5-2)6-3/h4-6H2,1-3H3 |
| P235 | InChIKey | ZMANZCXQSJIPKH-UHFFFAOYSA-N |
| P9557 | JECFA number | 1611 |
| P8408 | KBpedia ID | Triethylamine |
| P665 | KEGG ID | C14691 |
| P2064 | KNApSAcK ID | C00050499 |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP009395 |
| P6366 | Microsoft Academic ID (discontinued) | 2781283055 |
| P9405 | NMRShiftDB structure ID | 10016920 |
| P10283 | OpenAlex ID | C2781283055 |
| P12594 | OSHA Occupational Chemical Database ID | 165 |
| P11949 | PesticideInfo chemical ID | PRI6394 |
| P662 | PubChem CID | 8471 |
| P1579 | Reaxys registry number | 605283 |
| P657 | RTECS number | YE0175000 |
| P3345 | RxNorm CUI | 1307097 |
| P5076 | Römpp online ID | RD-20-02849 |
| P4964 | SPLASH | splash10-000i-9000000000-5ac6f611cfc4eb91767d |
| P2877 | SureChEMBL ID | 30 |
| P2877 | SureChEMBL ID | 124190 |
| P695 | UN number | 1296 |
| P11089 | UniChem compound ID | 76105 |
| P652 | UNII | VOU728O6AY |
| P679 | ZVG number | 18390 |
Why not click here or view trends?
log id: 4829561