Abstract is: Sclerotiorin is an antimicrobial Penicillium frequentans isolate. Sclerotiorin is an aldose reductase inhibitor (IC50=0.4 μM) as well as a reversible lipoxygenase inhibitor (IC50=4.2 μM).
| type of chemical entity | Q113145171 |
| Acetic acid [5-chloro-3-(3,5-dimethylhepta-1,3-dienyl)-7-methyl-6,8-dioxo-2-benzopyran-7-yl] ester | Q27195441 |
| P233 | canonical SMILES | CCC(C)C=C(C)C=CC1=CC2=C(C(=O)C(C(=O)C2=CO1)(C)OC(=O)C)Cl |
| P231 | CAS Registry Number | 549-23-5 |
| P683 | ChEBI ID | 186034 |
| P592 | ChEMBL ID | CHEMBL1095515 |
| P661 | ChemSpider ID | 4940697 |
| P646 | Freebase ID | /m/0wr63zb |
| P234 | InChI | InChI=1S/C21H23ClO5/c1-6-12(2)9-13(3)7-8-15-10-16-17(11-26-15)19(24)21(5,27-14(4)23)20(25)18(16)22/h7-12H,6H2,1-5H3/b8-7+,13-9+/t12-,21+/m0/s1 |
| P235 | InChIKey | SWJLTKXURNHVHE-UPWXJBBJSA-N |
| P2017 | isomeric SMILES | CC[C@H](C)/C=C(\C)/C=C/C1=CC2=C(C(=O)[C@](C(=O)C2=CO1)(C)OC(=O)C)Cl |
| P2064 | KNApSAcK ID | C00052463 |
| P6366 | Microsoft Academic ID | 2780892471 |
| P11199 | Probes And Drugs ID | PD020627 |
| P662 | PubChem CID | 6436015 |
| P11089 | UniChem compound ID | 430437 |
| P652 | UNII | BA54VZ8Z50 |
| P1343 | described by source | Synthesis of the azaphilones (+)-sclerotiorin and (+)-8-O-methylsclerotiorinamine utilizing (+)-sparteine surrogates in copper-mediated oxidative dearomatization | Q33845096 |
| P703 | found in taxon | Arcopilus aureus | Q56904411 |
| Pyrenula japonica | Q104096364 | ||
| Penicillium citreonigrum | Q10622901 | ||
| Penicillium multicolor | Q10622995 | ||
| Penicillium sclerotiorum | Q10623059 | ||
| P2067 | mass | 390.123402 |
| Q48789065 | Azapbilones with Endothelin Receptor Binding Activity Produced by Penicillium sclerotiorum: Taxonomy, Fermentation, Isolation, Structure Elucidation and Biological Activity |
| Q42945999 | Azaphilone and isocoumarin derivatives from the endophytic fungus Penicillium sclerotiorum PSU-A13. |
| Q34759138 | Bioactive metabolites from Chaetomium aureum: structure elucidation and inhibition of the Hsp90 machine chaperoning activity. |
| Q33884671 | Chemical epigenetics alters the secondary metabolite composition of guttate excreted by an atlantic-forest-soil-derived Penicillium citreonigrum |
| Q104397780 | Chlamydospore-like cell-inducing substances of fungi: Close correlation between chemical reactivity with methylamine and biological activity. |
| Q42277540 | Isochromophilones I and II, Novel Inhibitors against gpl20-CD4 Binding Produced by Penicillium multicolor FO-2338. I. Screening, Taxonomy, Fermentation, Isolation and Biological Activity |
| Q104846853 | Production of Xanthones with Free Radical Scavenging Properties, Emodin and Sclerotiorin by the Cultured Lichen Mycobionts of Pyrenula japonica |
| Q42589399 | Sclerotiorine, C(20)H(20)O(5)Cl, a chlorine-containing metabolic product of Penicillium sclerotiorum van Beyma |
| Q41947256 | Studies in the biochemistry of micro-organisms. Metabolic products of Penicillium multicolor G.-M. and P. with special reference to sclerotiorin |
| Sclerotiorin | wikipedia | |
| Serbo-Croatian (sh / Q9301) | Sklerotiorin | wikipedia |
| Sklerotiorin | wikipedia | |
| Sklerotiorin | wikipedia |
Search more.