Wikidata entity: Q15427850
C₂₀H₄₁NO₂ (P274)
Quantities
| P2067 | mass | 327.314 |
| P233 | canonical SMILES | String | CCCCCCCCCCCCCCCCCC(=O)NCCO | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21132652 (G protein-coupled receptor 119) | G protein-coupled receptor 119 |
| P279 | subclass of | ... | Q10483908 (endocannabinoids) | endocannabinoids |
| P231 | CAS Registry Number | 111-57-9 |
| P683 | ChEBI ID | 85299 |
| P592 | ChEMBL ID | CHEMBL171447 |
| P661 | ChemSpider ID | 25958 |
| P3073 | CosIng number | 78878 |
| P8494 | DSSTOX compound identifier | DTXCID7022178 |
| P3117 | DSSTox substance ID | DTXSID9042178 |
| P232 | EC number | 203-883-2 |
| P2566 | ECHA Substance Infocard ID | 100.003.531 |
| P646 | Freebase ID | /m/0wxqqv3 |
| P595 | Guide to Pharmacology Ligand ID | 3621 |
| P2057 | Human Metabolome Database ID | HMDB0013078 |
| P234 | InChI | InChI=1S/C20H41NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-20(23)21-18-19-22/h22H,2-19H2,1H3,(H,21,23) |
| P235 | InChIKey | OTGQIQQTPXJQRG-UHFFFAOYSA-N |
| P2063 | LIPID MAPS ID | LMFA08040051 |
| P6366 | Microsoft Academic ID (discontinued) | 2777142771 |
| P2840 | NSC number | 3377 |
| P2840 | NSC number | 52619 |
| P11199 | Probes And Drugs ID | PD020542 |
| P662 | PubChem CID | 27902 |
| P1579 | Reaxys registry number | 1794164 |
| P3345 | RxNorm CUI | 1426353 |
| P2877 | SureChEMBL ID | 50178 |
| P8691 | SwissLipids ID | SLM:000390186 |
| P11089 | UniChem compound ID | 36103 |
| P652 | UNII | 03XV449Q24 |
Why not click here or view trends?
log id: 2275401