Wikidata entity: Q1649219
C₁₂H₁₇NO (P274)
Quantities
| P2067 | mass | 191.131014 |
| P233 | canonical SMILES | String | CC1C(OCCN1C)C2=CC=CC=C2 | ??? |
| P373 | Commons category | String | Phendimetrazine | ??? |
| P1343 | described by source | ... | Q316572 (Opium Law) | Opium Law |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Phendimetrazine-3D-vdW.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@H]1[C@@H](OCCN1C)C2=CC=CC=C2 | ??? |
| P2175 | medical condition treated | ... | Q12174 (obesity) | obesity |
| P769 | significant drug interaction | ... | Q402633 ((±)-deprenyl) | (±)-deprenyl |
| P769 | significant drug interaction | ... | Q409595 (isocarboxazid) | isocarboxazid |
| P769 | significant drug interaction | ... | Q418656 (procarbazine) | procarbazine |
| P769 | significant drug interaction | ... | Q420885 (tranylcypromine) | tranylcypromine |
| P769 | significant drug interaction | ... | Q1747559 (phenelzine) | phenelzine |
| P279 | subclass of | ... | Q126615441 (Bontril) | Bontril |
| P2868 | subject has role | ... | Q211036 (stimulant) | stimulant |
| P2868 | subject has role | ... | Q410954 (monoamine oxidase inhibitor) | monoamine oxidase inhibitor |
| P2868 | subject has role | ... | Q899647 (dopamine reuptake inhibitor) | dopamine reuptake inhibitor |
| P2868 | subject has role | ... | Q899668 (adrenergic uptake inhibitors) | adrenergic uptake inhibitors |
| P231 | CAS Registry Number | 634-03-7 |
| P683 | ChEBI ID | 8059 |
| P592 | ChEMBL ID | CHEMBL1744 |
| P661 | ChemSpider ID | 11950 |
| P715 | DrugBank ID | DB01579 |
| P11198 | DrugCentral ID | 2122 |
| P8494 | DSSTOX compound identifier | DTXCID103447 |
| P3117 | DSSTox substance ID | DTXSID1023447 |
| P232 | EC number | 211-204-6 |
| P2566 | ECHA Substance Infocard ID | 100.010.186 |
| P646 | Freebase ID | /m/063jbm |
| P2062 | HSDB ID | 3381 |
| P234 | InChI | InChI=1S/C12H17NO/c1-10-12(14-9-8-13(10)2)11-6-4-3-5-7-11/h3-7,10,12H,8-9H2,1-2H3/t10-,12+/m0/s1 |
| P235 | InChIKey | MFOCDFTXLCYLKU-CMPLNLGQSA-N |
| P665 | KEGG ID | D08347 |
| P486 | MeSH descriptor ID | C100294 |
| P6366 | Microsoft Academic ID (discontinued) | 2778315536 |
| P2115 | NDF-RT ID | N0000147970 |
| P2840 | NSC number | 169187 |
| P4235 | PatientsLikeMe treatment ID | phendimetrazine |
| P11199 | Probes And Drugs ID | PD016241 |
| P662 | PubChem CID | 30487 |
| P3417 | Quora topic ID | Phendimetrazine |
| P3345 | RxNorm CUI | 33272 |
| P2877 | SureChEMBL ID | 598950 |
| P11089 | UniChem compound ID | 1070011 |
| P652 | UNII | AB2794W8KV |
| P11143 | WikiProjectMed ID | Phendimetrazine |
Why not click here or view trends?
log id: 3071988