Wikidata entity: Q166476
C₂₈H₃₀N₂O₂ (P274)
Quantities
| P4250 | defined daily dose | 7.5 |
| P2067 | mass | 426.231 |
| P3780 | active ingredient in | ... | Q47521438 (Enablex) | Enablex |
| P233 | canonical SMILES | String | C1CN(CC1C(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)N)CCC4=CC5=C(C=C4)OCC5 | ??? |
| P373 | Commons category | String | Darifenacin | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1CN(C[C@@H]1C(C2=CC=CC=C2)(C3=CC=CC=C3)C(=O)N)CCC4=CC5=C(C=C4)OCC5 | ??? |
| P129 | physically interacts with | ... | Q2844056 (Cholinergic receptor muscarinic 3) | Cholinergic receptor muscarinic 3 |
| P129 | physically interacts with | ... | Q4847900 (Cholinergic receptor muscarinic 1) | Cholinergic receptor muscarinic 1 |
| P129 | physically interacts with | ... | Q4847910 (Cholinergic receptor muscarinic 2) | Cholinergic receptor muscarinic 2 |
| P3489 | pregnancy category | ... | Q3679234 (Australian pregnancy category B3) | Australian pregnancy category B3 |
| P3489 | pregnancy category | ... | Q28123617 (US pregnancy category C) | US pregnancy category C |
| P769 | significant drug interaction | ... | Q421381 (flecainide) | flecainide |
| P279 | subclass of | ... | Q126615921 (2-(1-(2-(2,3-Dihydrobenzofuran-5-yl)ethyl)pyrrolidin-3-yl)-2,2-diphenylacetamide) | 2-(1-(2-(2,3-Dihydrobenzofuran-5-yl)ethyl)pyrrolidin-3-yl)-2,2-diphenylacetamide |
| P2868 | subject has role | ... | Q3001265 (muscarinic antagonist) | muscarinic antagonist |
| P2868 | subject has role | ... | Q50430468 (urological agents) | urological agents |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | darifenacin | ??? |
| P267 | ATC code | G04BD10 |
| P231 | CAS Registry Number | 133099-04-4 |
| P683 | ChEBI ID | 391960 |
| P592 | ChEMBL ID | CHEMBL1346 |
| P661 | ChemSpider ID | 392054 |
| P715 | DrugBank ID | DB00496 |
| P11198 | DrugCentral ID | 784 |
| P8494 | DSSTOX compound identifier | DTXCID3028265 |
| P3117 | DSSTox substance ID | DTXSID2048290 |
| P232 | EC number | 603-704-1 |
| P2566 | ECHA Substance Infocard ID | 100.118.382 |
| P646 | Freebase ID | /m/0ddwfs |
| P595 | Guide to Pharmacology Ligand ID | 319 |
| P595 | Guide to Pharmacology Ligand ID | 321 |
| P2057 | Human Metabolome Database ID | HMDB0014639 |
| P234 | InChI | InChI=1S/C28H30N2O2/c29-27(31)28(23-7-3-1-4-8-23,24-9-5-2-6-10-24)25-14-17-30(20-25)16-13-21-11-12-26-22(19-21)15-18-32-26/h1-12,19,25H,13-18,20H2,(H2,29,31)/t25-/m1/s1 |
| P235 | InChIKey | HXGBXQDTNZMWGS-RUZDIDTESA-N |
| P665 | KEGG ID | D03654 |
| P10245 | MedlinePlus drug identifier | a605039 |
| P486 | MeSH descriptor ID | C101207 |
| P6366 | Microsoft Academic ID (discontinued) | 2779965259 |
| P2115 | NDF-RT ID | N0000023085 |
| P11199 | Probes And Drugs ID | PD009993 |
| P662 | PubChem CID | 444031 |
| P1579 | Reaxys registry number | 8449641 |
| P3345 | RxNorm CUI | 136198 |
| P2877 | SureChEMBL ID | 56574 |
| P2892 | UMLS CUI | C0529351 |
| P11089 | UniChem compound ID | 357180 |
| P652 | UNII | APG9819VLM |
| P11143 | WikiProjectMed ID | Darifenacin |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 7153 |
Why not click here or view trends?
log id: 2724339