Wikidata entity: Q17811448
C₂₄H₂₉NO₅ (P274)
Quantities
| P2067 | mass | 411.204573 |
| P233 | canonical SMILES | String | CCOC(=O)C(C)CC(CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O | ??? |
| P373 | Commons category | String | Sacubitril | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | CCOC(=O)[C@H](C)C[C@@H](CC1=CC=C(C=C1)C2=CC=CC=C2)NC(=O)CCC(=O)O | ??? |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | sacubitril | ??? |
| P231 | CAS Registry Number | 149709-62-6 |
| P683 | ChEBI ID | 134714 |
| P592 | ChEMBL ID | CHEMBL3137301 |
| P661 | ChemSpider ID | 7987587 |
| P715 | DrugBank ID | DB09292 |
| P11198 | DrugCentral ID | 5012 |
| P8494 | DSSTOX compound identifier | DTXCID3086861 |
| P3117 | DSSTox substance ID | DTXSID20164370 |
| P646 | Freebase ID | /m/011snj1c |
| P595 | Guide to Pharmacology Ligand ID | 7857 |
| P234 | InChI | InChI=1S/C24H29NO5/c1-3-30-24(29)17(2)15-21(25-22(26)13-14-23(27)28)16-18-9-11-20(12-10-18)19-7-5-4-6-8-19/h4-12,17,21H,3,13-16H2,1-2H3,(H,25,26)(H,27,28)/t17-,21+/m1/s1 |
| P235 | InChIKey | PYNXFZCZUAOOQC-UTKZUKDTSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2776754050 |
| P11623 | NCI Drug Dictionary ID | sacubitril |
| P2115 | NDF-RT ID | N0000191735 |
| P10283 | OpenAlex ID | C2775999527 |
| P10283 | OpenAlex ID | C2776754050 |
| P11199 | Probes And Drugs ID | PD009270 |
| P662 | PubChem CID | 9811834 |
| P3345 | RxNorm CUI | 1656328 |
| P2877 | SureChEMBL ID | 2707112 |
| P11089 | UniChem compound ID | 27193111 |
| P652 | UNII | 17ERJ0MKGI |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 9819 |
Why not click here or view trends?
log id: 3810862