Wikidata entity: Q179678
C₅H₈NNaO₄ (P274)
Quantities
| P2107 | decomposition point | 225 |
| P2067 | mass | 169.035 |
| P2101 | melting point | 165 |
| P233 | canonical SMILES | String | C(CC(=O)O)C(C(=O)[O-])N.[Na+] | ??? |
| P373 | Commons category | String | Monosodium glutamate | ??? |
| P1889 | different from | ... | Q27133129 (monosodium glutamate) | monosodium glutamate |
| P2079 | fabrication method | ... | Q844704 (extraction) | extraction |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q556 (hydrogen) | hydrogen |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P527 | has part(s) | ... | Q658 (sodium) | sodium |
| P366 | has use | ... | Q898745 (flavor enhancer) | flavor enhancer |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | [H+].[Na+].N[C@@H](CCC([O-])=O)C([O-])=O | ??? |
| P1748 | NCI Thesaurus ID | String | C82289 | ??? |
| P361 | part of | ... | Q22273565 (response to monosodium L-glutamate) | response to monosodium L-glutamate |
| P361 | part of | ... | Q22273566 (cellular response to monosodium L-glutamate) | cellular response to monosodium L-glutamate |
| P443 | pronunciation audio | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/LL-Q1571%20%28mar%29-Neelima64-%E0%A4%AE%E0%A5%8B%E0%A4%A8%E0%A5%8B%E0%A4%B8%E0%A5%8B%E0%A4%A1%E0%A4%BF%E0%A4%AF%E0%A4%AE%20%E0%A4%97%E0%A5%8D%E0%A4%B2%E0%A5%81%E0%A4%9F%E0%A4%BE%E0%A4%AE%E0%A5%87%E0%A4%9F.wav | ??? |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P3364 | stereoisomer of | ... | Q27133152 (monosodium D-glutamate) | monosodium D-glutamate |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P8061 | AGROVOC ID | c_12645 |
| P11931 | CAMEO Chemicals ID | 20715 |
| P231 | CAS Registry Number | 142-47-2 |
| P683 | ChEBI ID | 64243 |
| P592 | ChEMBL ID | CHEMBL2107256 |
| P661 | ChemSpider ID | 76943 |
| P3073 | CosIng number | 79487 |
| P8494 | DSSTOX compound identifier | DTXCID70906 |
| P3117 | DSSTox substance ID | DTXSID9020906 |
| P628 | E number | E621 |
| P232 | EC number | 205-538-1 |
| P2566 | ECHA Substance Infocard ID | 100.005.035 |
| P10565 | Encyclopedia of China (Third Edition) ID | 54820 |
| P10565 | Encyclopedia of China (Third Edition) ID | 195281 |
| P1417 | Encyclopædia Britannica Online ID | topic/monosodium-glutamate |
| P3219 | Encyclopædia Universalis ID | glutamate-de-sodium |
| P646 | Freebase ID | /m/0gv88 |
| P227 | GND ID | 4571038-7 |
| P2671 | Google Knowledge Graph ID | /g/120_gbcs |
| P11302 | Google Product Taxonomy ID | 4610 |
| P12385 | Gran Enciclopèdia Catalana ID | glutamat-monosodic |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0186334 |
| P2062 | HSDB ID | 580 |
| P234 | InChI | InChI=1S/C5H9NO4.Na/c6-3(5(9)10)1-2-4(7)8;/h3H,1-2,6H2,(H,7,8)(H,9,10);/q;+1/p-1/t3-;/m0./s1 |
| P235 | InChIKey | LPUQAYUQRXPFSQ-DFWYDOINSA-M |
| P3827 | JSTOR topic ID (archived) | monosodium-glutamate |
| P8408 | KBpedia ID | MonosodiumGlutamate |
| P8313 | Lex ID | mononatriumglutamat |
| P244 | Library of Congress authority ID | sh86006084 |
| P1149 | Library of Congress Classification | TX819.G55 |
| P486 | MeSH descriptor ID | D012970 |
| P672 | MeSH tree code | D12.125.067.625.349.850 |
| P672 | MeSH tree code | D12.125.119.409.349.575 |
| P6366 | Microsoft Academic ID (discontinued) | 2776989845 |
| P2004 | NALT ID | 25121 |
| P8885 | Namuwiki ID | MSG |
| P349 | NDL Authority ID | 00562659 |
| P2840 | NSC number | 135529 |
| P1820 | Open Food Facts food additive ID | e621-monosodium-glutamate |
| P5930 | Open Food Facts ingredient ID | en:e621 |
| P10283 | OpenAlex ID | C2776989845 |
| P10283 | OpenAlex ID | C2911028397 |
| P11199 | Probes And Drugs ID | PD063922 |
| P662 | PubChem CID | 23672308 |
| P662 | PubChem CID | 23676143 |
| P662 | PubChem CID | 70788954 |
| P662 | PubChem CID | 73415804 |
| P3417 | Quora topic ID | MSG |
| P3417 | Quora topic ID | Monosodium-Glutamate-MSG |
| P1579 | Reaxys registry number | 17456768 |
| P657 | RTECS number | MA1578000 |
| P3345 | RxNorm CUI | 1313974 |
| P10376 | ScienceDirect topic ID | agricultural-and-biological-sciences/monosodium-glutamate |
| P10376 | ScienceDirect topic ID | chemistry/monosodium-glutamate |
| P10376 | ScienceDirect topic ID | neuroscience/monosodium-glutamate |
| P5082 | Store medisinske leksikon ID | MSG |
| P2877 | SureChEMBL ID | 16336 |
| P2877 | SureChEMBL ID | 1897914 |
| P2877 | SureChEMBL ID | 284936 |
| P4527 | UK Parliament thesaurus ID | 11724 |
| P11089 | UniChem compound ID | 24093776 |
| P652 | UNII | C3C196L9FG |
| P12800 | Vikidia article ID | fr:Glutamate_de_sodium |
| P3553 | Zhihu topic ID | 19651859 |
| P679 | ZVG number | 492938 |
Why not click here or view trends?
log id: 5924868