Wikidata entity: Q179731
NaHCO₃ (P274)


Quantities
| P2107 | decomposition point | 60 |
| P2054 | density | 2.159 |
| P2067 | mass | 83.982338 |
| P233 | canonical SMILES | String | C(=O)(O)[O-].[Na+] | ??? |
| P373 | Commons category | String | Sodium bicarbonate | ??? |
| P1343 | described by source | ... | Q2657718 (Armenian Soviet Encyclopedia) | Armenian Soviet Encyclopedia |
| P1889 | different from | ... | Q29476 (baking powder) | baking powder |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P527 | has part(s) | ... | Q556 (hydrogen) | hydrogen |
| P527 | has part(s) | ... | Q409202 (bicarbonate ion) | bicarbonate ion |
| P527 | has part(s) | ... | Q3154110 (sodium ion) | sodium ion |
| P366 | has use | ... | Q12140 (medication) | medication |
| P366 | has use | ... | Q372301 (abrasive) | abrasive |
| P366 | has use | ... | Q189567 (food additive) | food additive |
| P366 | has use | ... | Q7553210 (soda blasting) | soda blasting |
| P366 | has use | ... | Q17147112 (intravenous sodium bicarbonate) | intravenous sodium bicarbonate |
| P366 | has use | ... | Q908833 (raising agent) | raising agent |
| P366 | has use | ... | Q1974312 (cleaning product) | cleaning product |
| P366 | has use | ... | Q2826769 (buffering agent) | buffering agent |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P3493 | legal status (medicine) | ... | Q879952 (boxed warning) | boxed warning |
| P2175 | medical condition treated | ... | Q202837 (cardiac arrest) | cardiac arrest |
| P2175 | medical condition treated | ... | Q223591 (gastroesophageal reflux disease) | gastroesophageal reflux disease |
| P2175 | medical condition treated | ... | Q537297 (heartburn) | heartburn |
| P2175 | medical condition treated | ... | Q653971 (indigestion) | indigestion |
| P2175 | medical condition treated | ... | Q1516211 (renal tubular acidosis) | renal tubular acidosis |
| P5008 | on focus list of Wikimedia project | ... | Q6173448 (Wikipedia:Vital articles/Level/4) | Wikipedia:Vital articles/Level/4 |
| P4952 | safety classification and labelling | ... | Q2005334 (Regulation (EC) No. 1272/2008) | Regulation (EC) No. 1272/2008 |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P279 | subclass of | ... | Q622311 (acid salt) | acid salt |
| P279 | subclass of | ... | Q56810858 (bicarbonate) | bicarbonate |
| P279 | subclass of | ... | Q1508568 (sodium salt) | sodium salt |
| P6363 | WordLift URL | Url | ??? |
| P7089 | AFCD PFKID | F000248 |
| P8491 | AHECC 2017 ID | 28363000 |
| P11293 | Amazon.com browse node | 6492289011 |
| P1014 | Art & Architecture Thesaurus ID | 300379979 |
| P267 | ATC code | B05XA02 |
| P267 | ATC code | B05CB04 |
| P2581 | BabelNet ID | 00008022n |
| P2581 | BabelNet ID | 00008022n |
| P268 | Bibliothèque nationale de France ID | 15558099k |
| P508 | BNCF Thesaurus ID | 36780 |
| P11931 | CAMEO Chemicals ID | 21013 |
| P231 | CAS Registry Number | 144-55-8 |
| P683 | ChEBI ID | 32139 |
| P592 | ChEMBL ID | CHEMBL1353 |
| P661 | ChemSpider ID | 8609 |
| P4696 | CIQUAL2017 ID | 11507 |
| P3073 | CosIng number | 37736 |
| P1036 | Dewey Decimal Classification | 546.38222 |
| P715 | DrugBank ID | DB01390 |
| P8494 | DSSTOX compound identifier | DTXCID901269 |
| P3117 | DSSTox substance ID | DTXSID9021269 |
| P628 | E number | E500(ii) |
| P232 | EC number | 205-633-8 |
| P2566 | ECHA Substance Infocard ID | 100.005.122 |
| P4746 | Elhuyar ZTH ID | 134021 |
| P1417 | Encyclopædia Britannica Online ID | science/sodium-bicarbonate |
| P10584 | FAOTERM ID | 5439 |
| P646 | Freebase ID | /m/014dn0 |
| P227 | GND ID | 4404786-1 |
| P7502 | Golden ID | Sodium_bicarbonate-3DAB3 |
| P11302 | Google Product Taxonomy ID | 5774 |
| P4342 | Great Norwegian Encyclopedia ID | natron |
| P4342 | Great Norwegian Encyclopedia ID | natriumhydrogenkarbonat |
| P595 | Guide to Pharmacology Ligand ID | 4507 |
| P7982 | Hrvatska enciklopedija ID | 56957 |
| P2062 | HSDB ID | 697 |
| P2057 | Human Metabolome Database ID | HMDB0303541 |
| P5220 | ICSC ID | 1044 |
| P234 | InChI | InChI=1S/CH2O3.Na/c2-1(3)4;/h(H2,2,3,4);/q;+1/p-1 |
| P235 | InChIKey | UIIMBOGNXHQVGW-UHFFFAOYSA-M |
| P3827 | JSTOR topic ID (archived) | sodium-bicarbonate |
| P8408 | KBpedia ID | SodiumBicarbonate |
| P665 | KEGG ID | D01203 |
| P665 | KEGG ID | C12603 |
| P244 | Library of Congress authority ID | sh94006042 |
| P10245 | MedlinePlus drug identifier | a682001 |
| P6694 | MeSH concept ID | M0026757 |
| P486 | MeSH descriptor ID | D017693 |
| P672 | MeSH tree code | D01.200.275.150.100.800 |
| P672 | MeSH tree code | D01.857.625 |
| P6366 | Microsoft Academic ID (discontinued) | 2776420369 |
| P12596 | museum-digital tag ID | 51252 |
| P8885 | Namuwiki ID | 탄산수소 나트륨 |
| P8189 | National Library of Israel J9U ID | 987007549267005171 |
| P950 | National Library of Spain SpMaBN ID (BNE v1.0) | XX4768333 |
| P11623 | NCI Drug Dictionary ID | sodium-bicarbonate |
| P2115 | NDF-RT ID | N0000146526 |
| P2085 | Nikkaji ID | J44.042F |
| P691 | NL CR AUT ID | ph394395 |
| P2840 | NSC number | 134031 |
| P1821 | Open Food Facts food category ID | bicarbonates-of-soda |
| P5930 | Open Food Facts ingredient ID | sodium-bicarbonate |
| P10283 | OpenAlex ID | C2776420369 |
| P4235 | PatientsLikeMe treatment ID | baking-soda |
| P4235 | PatientsLikeMe treatment ID | sodium-bicarbonate |
| P11949 | PesticideInfo chemical ID | PRI5743 |
| P11199 | Probes And Drugs ID | PD009521 |
| P8349 | Proleksis enciklopedija ID | 5452 |
| P662 | PubChem CID | 516892 |
| P3417 | Quora topic ID | Baking-Soda |
| P3417 | Quora topic ID | Bicarbonate-Soda |
| P3417 | Quora topic ID | Sodium-Bicarbonate |
| P1579 | Reaxys registry number | 4153970 |
| P657 | RTECS number | VZ0950000 |
| P3345 | RxNorm CUI | 36676 |
| P5076 | Römpp online ID | RD-14-00412 |
| P5082 | Store medisinske leksikon ID | natriumhydrogenkarbonat |
| P2877 | SureChEMBL ID | 83 |
| P2877 | SureChEMBL ID | 3899 |
| P2892 | UMLS CUI | C0074722 |
| P11089 | UniChem compound ID | 379430 |
| P652 | UNII | 8MDF5V39QO |
| P12800 | Vikidia article ID | fr:Bicarbonate_de_sodium |
| P12086 | WikiKids ID | Natriumwaterstofcarbonaat |
| P8814 | WordNet 3.1 Synset ID | 14800154-n |
| P13591 | Yale LUX ID | concept/5443b76f-7eec-44d3-8c3e-f473dfa65575 |
| P2347 | YSO ID | 23260 |
| P679 | ZVG number | 2440 |
Why not click here or view trends?
log id: 2771775