Abstract is: Pantothenic acid, also called vitamin B5 is a water-soluble B vitamin and therefore an essential nutrient. All animals require pantothenic acid in order to synthesize coenzyme A (CoA) – essential for fatty acid metabolism – as well as to, in general, synthesize and metabolize proteins, carbohydrates, and fats. Pantothenic acid is the combination of pantoic acid and β-alanine. Its name derives from the Greek pantos, meaning "from everywhere", as minimally, at least small quantities of pantothenic acid are found in nearly every food. Human deficiency is very rare. As a dietary supplement or animal feed ingredient, the form commonly used is calcium pantothenate because of chemical stability, and hence long product shelf life, compared to sodium pantothenate or free pantothenic acid.
| P7049 | AICS Chemical ID (BEING DELETED) | 5155 |
| P268 | Bibliothèque nationale de France ID | 124605133 |
| P508 | BNCF Thesaurus ID | 51218 |
| P233 | canonical SMILES | CC(C)(CO)C(C(=O)NCCC(=O)O)O |
| P231 | CAS Registry Number | 599-54-2 |
| P683 | ChEBI ID | 7916 |
| 29032 | ||
| P592 | ChEMBL ID | CHEMBL2110806 |
| P661 | ChemSpider ID | 963 |
| P715 | DrugBank ID | DB01783 |
| P8494 | DSSTOX compound identifier | DTXCID5027229 |
| P3117 | DSSTox substance ID | DTXSID7047229 |
| P232 | EC number | 209-965-4 |
| P2566 | ECHA Substance Infocard ID | 100.009.061 |
| P1417 | Encyclopædia Britannica Online ID | science/pantothenic-acid |
| P646 | Freebase ID | /m/0f4hc |
| P1578 | Gmelin number | 775395 |
| P227 | GND ID | 4257945-4 |
| P12385 | Gran Enciclopèdia Catalana ID | acid-pantotenic |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0129396 |
| 0129397 | ||
| P2924 | Great Russian Encyclopedia Online ID (old version) | 2703042 |
| P2057 | Human Metabolome Database ID | HMDB0000210 |
| HMDB0250782 | ||
| P234 | InChI | InChI=1S/C9H17NO5/c1-9(2,5-11)7(14)8(15)10-4-3-6(12)13/h7,11,14H,3-5H2,1-2H3,(H,10,15)(H,12,13)/p-1/t7-/m0/s1 |
| P235 | InChIKey | GHOKWGTUZJEAQD-UHFFFAOYSA-N |
| P5063 | Interlingual Index ID | i115828 |
| P2017 | isomeric SMILES | CC(C)(CO)[C@@H](O)C(=O)NCCC([O-])=O |
| P665 | KEGG ID | C00864 |
| D07413 | ||
| P2064 | KNApSAcK ID | C00001550 |
| P6385 | Krugosvet article | meditsina/pantotenovaya-kislota |
| P244 | Library of Congress authority ID | sh2001002934 |
| P6689 | MassBank accession ID | MSBNK-BGC_Munich-RP012301 |
| MSBNK-BGC_Munich-RP012302 | ||
| MSBNK-BGC_Munich-RP012303 | ||
| P486 | MeSH descriptor ID | D010205 |
| P672 | MeSH tree code | D02.478.520 |
| D12.125.042.070.500 | ||
| P6366 | Microsoft Academic ID | 2780420027 |
| P2004 | NALT ID | 27695 |
| P8189 | National Library of Israel J9U ID | 987007532616305171 |
| P349 | NDL Authority ID | 00569034 |
| P9405 | NMRShiftDB structure ID | 20249095 |
| P1245 | OmegaWiki Defined Meaning | 1191215 |
| P5930 | Open Food Facts ingredient ID | pantothenic-acid |
| vitamin-b5 | ||
| P10283 | OpenAlex ID | C2780420027 |
| P11199 | Probes And Drugs ID | PD008877 |
| P1051 | PSH ID | 6239 |
| P662 | PubChem CID | 988 |
| P1579 | Reaxys registry number | 1727062 |
| P4964 | SPLASH | splash10-0zfu-1950000000-e17ccf50735fd5171fc4 |
| P5082 | Store medisinske leksikon ID | pantotensyre |
| P2877 | SureChEMBL ID | SCHEMBL5437 |
| P11089 | UniChem compound ID | 1102927 |
| P652 | UNII | 66Y94D1203 |
| P3471 | WikiSkripta article ID | 5989 |
| P2347 | YSO ID | 25574 |
| P2102 | boiling point | 551.5 | |
| P1889 | different from | pantethine | Q228762 |
| P703 | found in taxon | Caenorhabditis elegans | Q91703 |
| Homo sapiens | Q15978631 | ||
| Chlamydomonas reinhardtii | Q291827 | ||
| P2067 | mass | 218.10339619191 | |
| P2101 | melting point | 183.83 | |
| P4952 | safety classification and labelling | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response | Q51139288 |
| P3364 | stereoisomer of | (R)-pantothenate | Q74411212 |
| P2868 | subject has role | vitamin B | Q183206 |
| primary metabolite | Q3333419 |
| Q63401278 | A Study to Compare Two Formulations of Xylometazoline/Dexpanthenol Nasal Spray for the Treatment of Nasal Congestion. |
| Q63337178 | Dexpanthenol Mouthwash to Treat Oral Mucositis |
| Q63321234 | Feasibility and Effectiveness of Micronutrients as Palliative Care Therapy in Patients With Congestive Heart Failure |
| Q63394900 | Monitoring, Detoxifying, and Rebalancing Metals During Front Line Acute Myeloid Leukemia (AML) and Myelodysplastic Syndrome (MDS) Therapy |
| Q63397535 | Safety and Tolerability of the Ophthalmic Gel PRO-167 Versus Corneregel® on Healthy Subjects. |
| Q63316729 | Study of the Efficacy of PedyPhar® Ointment on the Diabetic Foot Ulcers |
| Q61981564 | The Effectiveness of Micronutrient Supplements on Growth and Educational Achievement of Schoolchildren in Bangladesh |
| Q50294721 | PANK1/3/4 phosphorylate PanK |
| Q50294720 | PANK2 phosphorylates PanK |
| Q50294719 | SLC5A6 cotransports extracellular PanK and 2Na+ to cytosol |
| Q50294731 | Vanin hydrolyses pantetheine to PanK, 2AET |
| Q50274532 | vitamins transported by SMVT [cytosol] |
| Q50274531 | vitamins transported by SMVT [extracellular region] |
| Q90413982 | Absence of tmRNA Increases the Persistence to Cefotaxime and the Intercellular Accumulation of Metabolite GlcNAc in Aeromonas veronii |
| Q109722097 | Dissecting Metabolism of Leaf Nodules in Ardisia crenata and Psychotria punctata |
| Q115784055 | Dysregulation of Streptococcus pneumoniae zinc homeostasis breaks ampicillin resistance in a pneumonia infection model |
| Q35146407 | Experimental Raman and IR spectral and theoretical studies of vibrational spectrum and molecular structure of Pantothenic acid (vitamin B5). |
| Q52311187 | Genome-scale metabolic modeling of responses to polymyxins in Pseudomonas aeruginosa. |
| Q60932499 | Gluconeogenesis using glycerol as a substrate in bloodstream-form Trypanosoma brucei |
| Q58847188 | Integrated genomic and metabolomic profiling of ISC1, an emerging Leishmania donovani population in the Indian subcontinent |
| Q113954339 | Metabolic Responses of a Model Green Microalga Euglena gracilis to Different Environmental Stresses |
| Q36835411 | Metabolomics reveals an involvement of pantothenate for male production responding to the short-day stimulus in the water flea, Daphnia pulex |
| Q59335062 | Modeling Meets Metabolomics-The WormJam Consensus Model as Basis for Metabolic Studies in the Model Organism |
| Q63031878 | PANTOTHENIC ACID REQUIREMENT FOR SPORE COLOR IN NEUROSPORA CRASSA |
| Q88938546 | PROMIS, global analysis of PROtein-metabolite interactions using size separation in Arabidopsis thaliana |
| Q113954464 | Pantothenate biosynthesis is critical for chronic infection by the neurotropic parasite Toxoplasma gondii |
| Q112300959 | Proteome allocations change linearly with the specific growth rate of Saccharomyces cerevisiae under glucose limitation |
| Q93162012 | Rapid metabolic shifts occur during the transition between hunger and satiety in Drosophila melanogaster |
| Q36880073 | Salmonella modulates metabolism during growth under conditions that induce expression of virulence genes |
| Q51149477 | Survival, gene and metabolite responses of Litoria verreauxii alpina frogs to fungal disease chytridiomycosis. |
| Q50466319 | Unexpected similarities between the Schizosaccharomyces and human blood metabolomes, and novel human metabolites. |
| Q28483069 | Untargeted metabolomics reveals a lack of synergy between nifurtimox and eflornithine against Trypanosoma brucei |
| Q63390527 | D-Pantothenic acid | subclass of | P279 |
| Q74411212 | (R)-pantothenate | stereoisomer of | P3364 |
Search more.