Wikidata entity: Q18211488
C₃H₇MgO₆P (P274)
Quantities
| P2067 | mass | 193.983 |
| P233 | canonical SMILES | String | C(C(COP(=O)([O-])[O-])O)O.[Mg+2] | ??? |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P527 | has part(s) | ... | Q660 (magnesium) | magnesium |
| P527 | has part(s) | ... | Q674 (phosphorus) | phosphorus |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 927-20-8 |
| P661 | ChemSpider ID | 8188451 |
| P661 | ChemSpider ID | 21428267 |
| P3073 | CosIng number | 85015 |
| P8494 | DSSTOX compound identifier | DTXCID601347940 |
| P3117 | DSSTox substance ID | DTXSID00919002 |
| P232 | EC number | 213-149-3 |
| P2566 | ECHA Substance Infocard ID | 100.011.955 |
| P2671 | Google Knowledge Graph ID | /g/1q5z82brs |
| P234 | InChI | InChI=1S/C3H9O6P.Mg/c4-1-3(5)2-9-10(6,7)8;/h3-5H,1-2H2,(H2,6,7,8);/q;+2/p-2 |
| P235 | InChIKey | BHJKUVVFSKEBEX-UHFFFAOYSA-L |
| P662 | PubChem CID | 10012877 |
| P2877 | SureChEMBL ID | 730522 |
| P11089 | UniChem compound ID | 22815237 |
| P652 | UNII | 89I3KNZ71G |
Why not click here or view trends?
log id: 3746578