Wikidata entity: Q189334
C₅H₈N₄O₁₂ (P274)
Quantities
| P2067 | mass | 316.014 |
| P233 | canonical SMILES | String | C(C(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-])O[N+](=O)[O-] | ??? |
| P373 | Commons category | String | Pentaerythritol tetranitrate | ??? |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q180762 (angina pectoris) | angina pectoris |
| P361 | part of | ... | Q22276593 (pentaerythritol tetranitrate metabolic process) | pentaerythritol tetranitrate metabolic process |
| P129 | physically interacts with | ... | Q21110352 (Guanylate cyclase 1 soluble subunit alpha 2) | Guanylate cyclase 1 soluble subunit alpha 2 |
| P129 | physically interacts with | ... | Q21110359 (Guanylate cyclase 1 soluble subunit beta 1) | Guanylate cyclase 1 soluble subunit beta 1 |
| P460 | said to be the same as | ... | Q3899224 (pentaerythritol tetranitrate) | pentaerythritol tetranitrate |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q50316227 (nitric oxide donors) | nitric oxide donors |
| P2868 | subject has role | ... | Q4008956 (vasodilator agent) | vasodilator agent |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | pentaerithrityl tetranitrate | ??? |
| P267 | ATC code | C01DA05 |
| P11931 | CAMEO Chemicals ID | 12283 |
| P231 | CAS Registry Number | 78-11-5 |
| P683 | ChEBI ID | 25879 |
| P592 | ChEMBL ID | CHEMBL466659 |
| P661 | ChemSpider ID | 6271 |
| P11375 | CSD Refcode | PERYTN |
| P715 | DrugBank ID | DB06154 |
| P11198 | DrugCentral ID | 2087 |
| P8494 | DSSTOX compound identifier | DTXCID901109 |
| P3117 | DSSTox substance ID | DTXSID2023430 |
| P232 | EC number | 201-084-3 |
| P2566 | ECHA Substance Infocard ID | 100.000.987 |
| P4746 | Elhuyar ZTH ID | 029444 |
| P10565 | Encyclopedia of China (Third Edition) ID | 301450 |
| P1417 | Encyclopædia Britannica Online ID | science/PETN |
| P646 | Freebase ID | /m/0bn42 |
| P12385 | Gran Enciclopèdia Catalana ID | pentrita |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0130838 |
| P7025 | HCIS ID | 3378 |
| P2062 | HSDB ID | 6313 |
| P2057 | Human Metabolome Database ID | HMDB0256253 |
| P5220 | ICSC ID | 1576 |
| P234 | InChI | InChI=1S/C5H8N4O12/c10-6(11)18-1-5(2-19-7(12)13,3-20-8(14)15)4-21-9(16)17/h1-4H2 |
| P235 | InChIKey | TZRXHJWUDPFEEY-UHFFFAOYSA-N |
| P8408 | KBpedia ID | PETN |
| P665 | KEGG ID | D01721 |
| P8313 | Lex ID | pentrit |
| P244 | Library of Congress authority ID | sh90003290 |
| P486 | MeSH descriptor ID | D010417 |
| P672 | MeSH tree code | D02.033.455.706.690 |
| P6366 | Microsoft Academic ID (discontinued) | 2776486069 |
| P8189 | National Library of Israel J9U ID | 987007529892405171 |
| P2115 | NDF-RT ID | N0000146783 |
| P7305 | Online PWN Encyclopedia ID | 3955795 |
| P10283 | OpenAlex ID | C2776486069 |
| P11199 | Probes And Drugs ID | PD014201 |
| P662 | PubChem CID | 6518 |
| P1579 | Reaxys registry number | 1716886 |
| P3345 | RxNorm CUI | 7992 |
| P2877 | SureChEMBL ID | 37177 |
| P8121 | UM-BBD compound ID | c0051 |
| P2892 | UMLS CUI | C0030858 |
| P11089 | UniChem compound ID | 384966 |
| P652 | UNII | 10L39TRG1Z |
| P13591 | Yale LUX ID | concept/54470a88-8857-432e-867b-8decd199d9c2 |
| P679 | ZVG number | 490092 |
Why not click here or view trends?
log id: 5025507