Wikidata entity: Q191831
H₈N₂O₄S (P274)
Quantities
| P2107 | decomposition point | 218 |
| P2054 | density | 1.769 |
| P2067 | mass | 132.020477736 |
| P3078 | standard enthalpy of formation | -1180 |
| P233 | canonical SMILES | String | [NH4+].[NH4+].[O-]S(=O)(=O)[O-] | ??? |
| P373 | Commons category | String | Ammonium sulfate | ??? |
| P1343 | described by source | ... | Q2041543 (Otto's encyclopedia) | Otto's encyclopedia |
| P1343 | described by source | ... | Q123560817 (Armenian Soviet Encyclopedia, vol. 1) | Armenian Soviet Encyclopedia, vol. 1 |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P527 | has part(s) | ... | Q556 (hydrogen) | hydrogen |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q682 (sulfur) | sulfur |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P5008 | on focus list of Wikimedia project | ... | Q6173448 (Wikipedia:Vital articles/Level/4) | Wikipedia:Vital articles/Level/4 |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P279 | subclass of | ... | Q906629 (nitrogen fertilizer) | nitrogen fertilizer |
| P279 | subclass of | ... | Q12370 (salt) | salt |
| P1014 | Art & Architecture Thesaurus ID | 300389870 |
| P11931 | CAMEO Chemicals ID | 10477 |
| P231 | CAS Registry Number | 7783-20-2 |
| P683 | ChEBI ID | 62946 |
| P592 | ChEMBL ID | CHEMBL2107724 |
| P661 | ChemSpider ID | 22944 |
| P3073 | CosIng number | 31899 |
| P8494 | DSSTOX compound identifier | DTXCID909704 |
| P3117 | DSSTox substance ID | DTXSID1029704 |
| P628 | E number | E517 |
| P232 | EC number | 231-984-1 |
| P2566 | ECHA Substance Infocard ID | 100.029.076 |
| P9545 | Encyclopedia of China (Second Edition) ID | 218078 |
| P1417 | Encyclopædia Britannica Online ID | science/ammonium-sulfate |
| P646 | Freebase ID | /m/058svw |
| P227 | GND ID | 4299792-6 |
| P12385 | Gran Enciclopèdia Catalana ID | sulfat-damoni |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0220022 |
| P4342 | Great Norwegian Encyclopedia ID | ammoniumsulfat |
| P2062 | HSDB ID | 471 |
| P234 | InChI | InChI=1S/2H3N.H2O4S/c;;1-5(2,3)4/h2*1H3;(H2,1,2,3,4) |
| P235 | InChIKey | BFNBIHQBYMNNAN-UHFFFAOYSA-N |
| P8408 | KBpedia ID | AmmoniumSulfate |
| P665 | KEGG ID | D08853 |
| P486 | MeSH descriptor ID | D000645 |
| P672 | MeSH tree code | D01.625.062.374 |
| P672 | MeSH tree code | D01.875.800.800.850.050 |
| P6366 | Microsoft Academic ID (discontinued) | 2780925461 |
| P349 | NDL Authority ID | 00569904 |
| P2840 | NSC number | 77671 |
| P1820 | Open Food Facts food additive ID | e517-ammonium-sulphate |
| P10283 | OpenAlex ID | C2780925461 |
| P11949 | PesticideInfo chemical ID | PRI1231 |
| P662 | PubChem CID | 24538 |
| P662 | PubChem CID | 6097028 |
| P3417 | Quora topic ID | Ammonium-Sulfate |
| P1579 | Reaxys registry number | 11343144 |
| P3345 | RxNorm CUI | 1362695 |
| P2877 | SureChEMBL ID | 4821 |
| P2877 | SureChEMBL ID | 4638217 |
| P2892 | UMLS CUI | C0002620 |
| P11089 | UniChem compound ID | 1098743 |
| P652 | UNII | SU46BAM238 |
| P13591 | Yale LUX ID | concept/2b767532-6daf-47ba-92e4-2d54279ccfd6 |
| P679 | ZVG number | 1470 |
Why not click here or view trends?
log id: 8997531