Wikidata entity: Q1958189
C₁₄H₂₂BrN₃O₂ (P274)
Quantities
| P4250 | defined daily dose | 20 |
| P2067 | mass | 343.089539 |
| P233 | canonical SMILES | String | CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Br | ??? |
| P373 | Commons category | String | Bromopride | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P1987 | MCN code | String | 2924.29.51 | ??? |
| P2175 | medical condition treated | ... | Q653971 (indigestion) | indigestion |
| P636 | route of administration | ... | Q285166 (oral administration) | oral administration |
| P636 | route of administration | ... | Q432083 (intramuscular injection) | intramuscular injection |
| P636 | route of administration | ... | Q640448 (intravenous infusion and defusion) | intravenous infusion and defusion |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q575136 (antiemetic) | antiemetic |
| P2868 | subject has role | ... | Q3271533 (dopamine antagonist) | dopamine antagonist |
| P267 | ATC code | A03FA04 |
| P231 | CAS Registry Number | 4093-35-0 |
| P683 | ChEBI ID | 95304 |
| P592 | ChEMBL ID | CHEMBL399510 |
| P661 | ChemSpider ID | 2352 |
| P715 | DrugBank ID | DB09018 |
| P11198 | DrugCentral ID | 406 |
| P8494 | DSSTOX compound identifier | DTXCID8025383 |
| P3117 | DSSTox substance ID | DTXSID0045383 |
| P232 | EC number | 223-842-2 |
| P2566 | ECHA Substance Infocard ID | 100.021.675 |
| P646 | Freebase ID | /m/02w49r8 |
| P234 | InChI | InChI=1S/C14H22BrN3O2/c1-4-18(5-2)7-6-17-14(19)10-8-11(15)12(16)9-13(10)20-3/h8-9H,4-7,16H2,1-3H3,(H,17,19) |
| P235 | InChIKey | GIYAQDDTCWHPPL-UHFFFAOYSA-N |
| P665 | KEGG ID | D07101 |
| P486 | MeSH descriptor ID | C013855 |
| P6366 | Microsoft Academic ID (discontinued) | 2781076963 |
| P2840 | NSC number | 758391 |
| P11199 | Probes And Drugs ID | PD001072 |
| P662 | PubChem CID | 2446 |
| P3345 | RxNorm CUI | 19768 |
| P2877 | SureChEMBL ID | 54497 |
| P11089 | UniChem compound ID | 344939 |
| P652 | UNII | 75473V2YZK |
Why not click here or view trends?
log id: 5760607