Wikidata entity: Q2055416
C₁₅H₂₄O (P274)
Quantities
| P2067 | mass | 220.182715 |
| P233 | canonical SMILES | String | CC(=CCCC1(C2CCC(C2)C1=C)C)CO | ??? |
| P703 | found in taxon | ... | Q210858 (Santalum album) | Santalum album |
| P703 | found in taxon | ... | Q3018287 (Santalum spicatum) | Santalum spicatum |
| P703 | found in taxon | ... | Q15240100 (Atalantia buxifolia) | Atalantia buxifolia |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C/C(=C/CC[C@@]1([C@H]2CC[C@H](C2)C1=C)C)/CO | ??? |
| P3364 | stereoisomer of | ... | Q67880221 ((E)-beta-santalol) | (E)-beta-santalol |
| P3364 | stereoisomer of | ... | Q81982053 ((+/-)-beta-Santalol) | (+/-)-beta-Santalol |
| P3364 | stereoisomer of | ... | Q81982054 (rel-(2E)-2-Methyl-5-[(1R,2S,4S)-2-methyl-3-methylenebicyclo[2.2.1]hept-2-yl]-2-penten-1-ol) | rel-(2E)-2-Methyl-5-[(1R,2S,4S)-2-methyl-3-methylenebicyclo[2.2.1]hept-2-yl]-2-penten-1-ol |
| P3364 | stereoisomer of | ... | Q105193396 ((Z)-beta-santalol) | (Z)-beta-santalol |
| P3364 | stereoisomer of | ... | Q105193398 (2-methyl-5-[(1R,2R,4S)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]pent-2-en-1-ol) | 2-methyl-5-[(1R,2R,4S)-2-methyl-3-methylidene-2-bicyclo[2.2.1]heptanyl]pent-2-en-1-ol |
| P3364 | stereoisomer of | ... | Q110077204 (cis-beta-epiSantalol) | cis-beta-epiSantalol |
| P279 | subclass of | ... | Q4214615 (carbocyclic compound) | carbocyclic compound |
| P279 | subclass of | ... | Q108304682 (santalanes) | santalanes |
| P231 | CAS Registry Number | 77-42-9 |
| P683 | ChEBI ID | 10441 |
| P592 | ChEMBL ID | CHEMBL3586094 |
| P661 | ChemSpider ID | 20118119 |
| P3073 | CosIng number | 41090 |
| P3117 | DSSTox substance ID | DTXSID1051567 |
| P3117 | DSSTox substance ID | DTXSID70892297 |
| P232 | EC number | 201-027-2 |
| P2566 | ECHA Substance Infocard ID | 100.000.935 |
| P9066 | FL number | 02.216 |
| P646 | Freebase ID | /m/03m4npd |
| P2057 | Human Metabolome Database ID | HMDB0036716 |
| P234 | InChI | InChI=1S/C15H24O/c1-11(10-16)5-4-8-15(3)12(2)13-6-7-14(15)9-13/h5,13-14,16H,2,4,6-10H2,1,3H3/b11-5-/t13-,14+,15+/m1/s1 |
| P235 | InChIKey | OJYKYCDSGQGTRJ-GQYWAMEOSA-N |
| P665 | KEGG ID | C09720 |
| P2063 | LIPID MAPS ID | LMPR0103800003 |
| P6366 | Microsoft Academic ID (discontinued) | 2781260031 |
| P662 | PubChem CID | 6857681 |
| P2877 | SureChEMBL ID | 301322 |
| P11089 | UniChem compound ID | 1101392 |
| P652 | UNII | 1JL7K2LW6L |
Why not click here or view trends?
log id: 5025720