Wikidata entity: Q21060907
H₂B₄NaO₈⁻ (P274)
Quantities
| P2067 | mass | 197.00250648391 |
| P2101 | melting point | 392 |
| P2177 | solubility | 3 |
| P2404 | time-weighted average exposure limit | 1 |
| P2119 | vapor pressure | 0 |
| P3335 | associated hazard | ... | Q21168166 (sodium tetraborate pentahydrate exposure) | sodium tetraborate pentahydrate exposure |
| P233 | canonical SMILES | String | B1(OB2OB(OB(O1)O2)[O-])[O-].O.[Na+] | ??? |
| P1542 | has effect | ... | Q21168166 (sodium tetraborate pentahydrate exposure) | sodium tetraborate pentahydrate exposure |
| P4770 | hydrated form of | ... | Q5319 (borax) | borax |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q462174 (hydrate) | hydrate |
| P231 | CAS Registry Number | 12179-04-3 |
| P8494 | DSSTOX compound identifier | DTXCID5014389 |
| P3117 | DSSTox substance ID | DTXSID7034389 |
| P232 | EC number | 601-808-1 |
| P2566 | ECHA Substance Infocard ID | 100.131.090 |
| P7025 | HCIS ID | 1628 |
| P234 | InChI | InChI=1S/B4O7.Na.H2O/c5-1-7-3-9-2(6)10-4(8-1)11-3;;/h;;1H2/q-2;+1; |
| P235 | InChIKey | ONUOCAORSJVURX-UHFFFAOYSA-N |
| P12594 | OSHA Occupational Chemical Database ID | 170 |
| P662 | PubChem CID | 131634875 |
| P11089 | UniChem compound ID | 147714138 |
| P652 | UNII | SG2N20S03U |
Why not click here or view trends?
log id: 2266168