Wikidata entity: Q21098900
C₃₃H₄₄F₂N₂O₃ (P274)
Quantities
| P2067 | mass | 554.332 |
| P233 | canonical SMILES | String | CC1(CCC2(CCC3(C(C2C1)C(=O)C=C4C3(CCC5C4(C=C(C(=O)C5(C)C)C#N)C)C)C)NC(=O)C(C)(F)F)C | ??? |
| P373 | Commons category | String | Omaveloxolone | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@@]12CC[C@]3(CCC(C[C@H]3[C@H]1C(=O)C=C4[C@]2(CC[C@@H]5[C@@]4(C=C(C(=O)C5(C)C)C#N)C)C)(C)C)NC(=O)C(C)(F)F | ??? |
| P279 | subclass of | ... | Q177911 (steroid) | steroid |
| P279 | subclass of | ... | Q333936 (nitrile) | nitrile |
| P279 | subclass of | ... | Q2200141 (organofluorine) | organofluorine |
| P279 | subclass of | ... | Q72192270 (N-substituted primary carboxamide) | N-substituted primary carboxamide |
| P231 | CAS Registry Number | 1474034-05-3 |
| P683 | ChEBI ID | 229661 |
| P661 | ChemSpider ID | 34980948 |
| P715 | DrugBank ID | DB12513 |
| P3117 | DSSTox substance ID | DTXSID101138251 |
| P646 | Freebase ID | /m/01347y45 |
| P595 | Guide to Pharmacology Ligand ID | 7573 |
| P234 | InChI | InChI=1S/C33H44F2N2O3/c1-27(2)11-13-33(37-26(40)32(8,34)35)14-12-31(7)24(20(33)17-27)21(38)15-23-29(5)16-19(18-36)25(39)28(3,4)22(29)9-10-30(23,31)6/h15-16,20,22,24H,9-14,17H2,1-8H3,(H,37,40)/t20-,22-,24-,29-,30+,31+,33-/m0/s1 |
| P235 | InChIKey | RJCWBNBKOKFWNY-IDPLTSGASA-N |
| P11199 | Probes And Drugs ID | PD016358 |
| P662 | PubChem CID | 71811910 |
| P2877 | SureChEMBL ID | 15349371 |
| P4527 | UK Parliament thesaurus ID | 559891 |
| P11089 | UniChem compound ID | 69963012 |
| P652 | UNII | G69Z98951Q |
| P11143 | WikiProjectMed ID | Omaveloxolone |
Why not click here or view trends?
log id: 1836241