Abstract is: Captan is a general use pesticide (GUP) that belongs to the phthalimide class of fungicides. It is a white solid, although commercial samples appear yellow or brownish.
| P7049 | AICS Chemical ID (BEING DELETED) | 3729 |
| P7524 | CA PROP 65 ID | captan |
| P8072 | CAB ID | 83842 |
| P11931 | CAMEO Chemicals ID | 2803 |
| P11160 | Cannabis Database ID | 006303 |
| P233 | canonical SMILES | C1C=CCC2C1C(=O)N(C2=O)SC(Cl)(Cl)Cl |
| P231 | CAS Registry Number | 133-06-2 |
| P683 | ChEBI ID | 34608 |
| P592 | ChEMBL ID | CHEMBL388676 |
| P661 | ChemSpider ID | 8287 |
| P9272 | DeCS ID | 2250 |
| P8494 | DSSTOX compound identifier | DTXCID90243 |
| P3117 | DSSTox substance ID | DTXSID9020243 |
| P232 | EC number | 205-087-0 |
| P2566 | ECHA Substance Infocard ID | 100.004.626 |
| P646 | Freebase ID | /m/07d6nh |
| P12385 | Gran Enciclopèdia Catalana ID | captan |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0267783 |
| P7025 | HCIS ID | 815 |
| P2062 | HSDB ID | 951 |
| P2057 | Human Metabolome Database ID | HMDB0249599 |
| P5220 | ICSC ID | 0120 |
| P234 | InChI | InChI=1S/C9H8Cl3NO2S/c10-9(11,12)16-13-7(14)5-3-1-2-4-6(5)8(13)15/h1-2,5-6H,3-4H2 |
| P235 | InChIKey | LDVVMCZRFWMZSG-UHFFFAOYSA-N |
| P665 | KEGG ID | C14438 |
| P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP010740 |
| P486 | MeSH descriptor ID | D002215 |
| P672 | MeSH tree code | D03.633.100.513.124 |
| P6366 | Microsoft Academic ID | 2776255237 |
| P349 | NDL Authority ID | 00567092 |
| P1931 | NIOSH Pocket Guide ID | 0099 |
| P9405 | NMRShiftDB structure ID | 20208649 |
| P2840 | NSC number | 36726 |
| P10283 | OpenAlex ID | C2776255237 |
| P12594 | OSHA Occupational Chemical Database ID | 230 |
| P11949 | PesticideInfo chemical ID | PRI1867 |
| P11199 | Probes And Drugs ID | PD000669 |
| P662 | PubChem CID | 8606 |
| P657 | RTECS number | GW5075000 |
| P4964 | SPLASH | splash10-004i-7910000000-f439be3827e18f710559 |
| P2877 | SureChEMBL ID | SCHEMBL21047 |
| P11089 | UniChem compound ID | 374363 |
| P652 | UNII | EOL5G26Q9F |
| P679 | ZVG number | 10870 |
| P3335 | associated hazard | captan exposure | Q21173358 |
| P2107 | decomposition point | 352 | |
| P2054 | density | 1.74 | |
| P1552 | has characteristic | flammable solid | Q21073024 |
| P1542 | has effect | captan exposure | Q21173358 |
| P366 | has use | fungicide | Q193237 |
| industrial fungicides | Q50377184 | ||
| P2067 | mass | 298.934 | |
| P1987 | MCN code | 2930.90.91 | |
| P2177 | solubility | 0.0003 | |
| P2868 | subject has role | carcinogen | Q187661 |
| occupational carcinogen | Q21074597 | ||
| P2404 | time-weighted average exposure limit | 5 | |
| P2119 | vapor pressure | 0 |
FileName: Captan Structural Formula V.1.svg
Description: Captan
Artist: Jü
License: Public domain
FileName: Captan-from-xtal-1981-CM-3D-balls.png
Description:
Ball-and-stick model of the captan molecule, C9H8Cl3NO2S, as found in the crystal structure.
Colour code:
Crystal structure data from L. E. Moss, R. A. Jacobson, Cryst. Struct. Comm. (1981), 10, 1545–
Image generated in CrystalMaker 8.3.Artist: Ben Mills
License: Public domain
| Q40122287 | A moving robotic hand system for whole-glove permeation and penetration: captan and nitrile gloves |
| Q23912685 | A sampling and analytical method for the simultaneous determination of multiple organonitrogen pesticides in air |
| Q26236914 | A sampling and analytical method for the simultaneous determination of multiple organonitrogen pesticides in air |
| Q89717968 | Acrylonitrile content as a predictor of the captan permeation resistance for disposable nitrile rubber gloves |
| Q23915406 | An updated algorithm for estimation of pesticide exposure intensity in the Agricultural Health Study |
| Q46212632 | Analysis of captan on nitrile glove surfaces using a portable attenuated total reflection fourier transform infrared spectrometer |
| Q89710276 | Are all gloves created equal? Through the eyes of surface infrared reflectance |
| Q42788996 | Bacterial degradation of fungicide captan |
| Q23911779 | Cancer incidence among pesticide applicators exposed to captan in the Agricultural Health Study |
| Q70914946 | Captan |
| Q23911344 | Captan exposure and evaluation of a pesticide exposure algorithm among orchard pesticide applicators in the agricultural health study |
| Q23910681 | Determinants of captan air and dermal exposures among orchard pesticide applicators in the Agricultural Health Study |
| Q74410262 | Exposure to captan in fruit growing |
| Q64388763 | Exposure to the Fungicide Captan Induces DNA Base Alterations and Replicative Stress in Mammalian Cells |
| Q86908129 | Factors affecting the estimated probabilistic acute dietary exposure to captan from apple consumption |
| Q24718252 | Field and laboratory glove permeation studies with pesticide formulations |
| Q25017602 | Fungicide application practices and personal protective equipment use among orchard farmers in the agricultural health study |
| Q37766908 | Genetic toxicology of folpet and captan |
| Q26354546 | HETA Report Report No. TA-77-66, Platte Chemical Company, Fremont, Nebraska |
| Q26348437 | HHE determination report no. HHE-74-93-296, Calhio Chemicals, Inc., Perry, Ohio |
| Q26349997 | HHE report HHE-72-63-36, Ferry Morse Seed Company, Mountain View, California |
| Q26351169 | Health hazard evaluation report: HETA-94-0353-2629, USDA Plant Inspection and Quarantine Station, Miami, Florida |
| Q23919694 | Incomplete removal of the pesticide captan from skin by standard handwash exposure assessment procedures |
| Q26374019 | Industrial Hygiene Walkthrough Survey Report Of Calhio Chemicals, Inc., Subsidiary Of Stauffer Chemical Company, Perry, Ohio, Report No. IWS-147-24 |
| Q29009084 | NIOSH Manual of Analytical Methods, 4th edition, 3rd supplement |
| Q21761913 | NIOSH Method 5601: Organonitrogen Pesticides |
| Q21761866 | NIOSH Method 9202: Captan and Thiophanate-Methyl in Handrinse |
| Q21761867 | NIOSH Method 9205: Captan and Thiophanate-Methyl on Dermal Patch |
| Q26369730 | Occupational safety and health guidelines for chemical hazards. Supplement IV-OHG |
| Q89710287 | Permeation of captan formulation through nitrile protective glove material |
| Q23919810 | Permeation of captan through disposable nitrile glove |
| Q25893204 | Permeation of of irritant mixtures through protective materials |
| Q26373914 | Possible Teratogenic And Carcinogenic Effects Of Pesticides On Human Health |
| Q26325340 | Possible Teratogenic and Carcinogenic Effects of Pesticides on Human Health |
| Q77790509 | Prenatal exposure to the herbicide 2,4-D is associated with deficits in auditory processing during infancy |
| Q43725638 | Systematic toxicological analysis revealing a rare case of captan ingestion |
| Q89717890 | The influence of hand movement on the permeation and penetration of captan through disposable nitrile rubber gloves |
| Q43078338 | Thermal decomposition of captan and formation pathways of toxic air pollutants. |
| Q56839530 | Toxicokinetics of captan and folpet biomarkers in dermally exposed volunteers |
| Q83550066 | Toxicokinetics of captan and folpet biomarkers in orally exposed volunteers |
| Q46948576 | Variability in surface infrared reflectance of thirteen nitrile rubber gloves at key wavelengths for analysis of captan |
| Q63409391 | (3aS,7aR)-2-(trichloromethylsulfanyl)-3a,4,7,7a-tetrahydroisoindole-1,3-dione | subclass of | P279 |
| Q21173358 | captan exposure | has cause | P828 |
| Category:Captan | wikimedia | |
| Arabic (ar / Q13955) | كابتان | wikipedia |
| azb | کاپتان | wikipedia |
| Catalan (ca / Q7026) | Captan | wikipedia |
| Captan | wikipedia | |
| Captan | wikipedia | |
| Captan | wikipedia | |
| Persian (fa / Q9168) | کاپتان | wikipedia |
| Kaptaani | wikipedia | |
| Captane | wikipedia | |
| Kaptán | wikipedia | |
| キャプタン | wikipedia | |
| Captan | wikipedia | |
| Kaptan | wikipedia | |
| Serbo-Croatian (sh / Q9301) | Kaptan | wikipedia |
| Kaptan | wikipedia | |
| 蓋普丹 | wikipedia |
Search more.