Wikidata entity: Q2359590
C₁₀H₁₁F₃N₂O₅ (P274)
Quantities
| P2067 | mass | 296.062006 |
| P3780 | active ingredient in | ... | Q47522302 (Viroptic) | Viroptic |
| P233 | canonical SMILES | String | C1C(C(OC1N2C=C(C(=O)NC2=O)C(F)(F)F)CO)O | ??? |
| P972 | catalog | ... | Q90481889 (CAS COVID-19 Anti-Viral Candidate Compounds) | CAS COVID-19 Anti-Viral Candidate Compounds |
| P373 | Commons category | String | Trifluridine | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1[C@@H]([C@H](O[C@H]1N2C=C(C(=O)NC2=O)C(F)(F)F)CO)O | ??? |
| P8026 | LiverTox likelihood score | ... | Q83284667 (LiverTox toxicity likelihood category E) | LiverTox toxicity likelihood category E |
| P2175 | medical condition treated | ... | Q1258984 (herpes simplex virus keratitis) | herpes simplex virus keratitis |
| P2175 | medical condition treated | ... | Q6473911 (herpes simplex) | herpes simplex |
| P2175 | medical condition treated | ... | Q18555025 (colon cancer) | colon cancer |
| P2175 | medical condition treated | ... | Q18555196 (rectosigmoid cancer) | rectosigmoid cancer |
| P2175 | medical condition treated | ... | Q2739660 (rectum cancer) | rectum cancer |
| P2175 | medical condition treated | ... | Q4781026 (appendix cancer) | appendix cancer |
| P3489 | pregnancy category | ... | Q28123617 (US pregnancy category C) | US pregnancy category C |
| P279 | subclass of | ... | Q2689559 (nucleoside analogue) | nucleoside analogue |
| P2868 | subject has role | ... | Q804539 (bactericide) | bactericide |
| P2868 | subject has role | ... | Q846227 (antiviral drug) | antiviral drug |
| P2868 | subject has role | ... | Q4118287 (DNA polymerase inhibitors) | DNA polymerase inhibitors |
| P2868 | subject has role | ... | Q40207875 (antiviral agent) | antiviral agent |
| P2868 | subject has role | ... | Q50429865 (antimetabolite) | antimetabolite |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | trifluridine | ??? |
| P267 | ATC code | S01AD02 |
| P231 | CAS Registry Number | 70-00-8 |
| P683 | ChEBI ID | 75179 |
| P592 | ChEMBL ID | CHEMBL1129 |
| P661 | ChemSpider ID | 6020 |
| P9272 | DeCS ID | 30424 |
| P715 | DrugBank ID | DB00432 |
| P11198 | DrugCentral ID | 2743 |
| P8494 | DSSTOX compound identifier | DTXCID2026602 |
| P3117 | DSSTox substance ID | DTXSID4046602 |
| P232 | EC number | 200-722-8 |
| P2566 | ECHA Substance Infocard ID | 100.000.657 |
| P646 | Freebase ID | /m/0fmlt3 |
| P595 | Guide to Pharmacology Ligand ID | 8697 |
| P2062 | HSDB ID | 8126 |
| P2057 | Human Metabolome Database ID | HMDB0014576 |
| P234 | InChI | InChI=1S/C10H11F3N2O5/c11-10(12,13)4-2-15(9(19)14-8(4)18)7-1-5(17)6(3-16)20-7/h2,5-7,16-17H,1,3H2,(H,14,18,19)/t5-,6+,7+/m0/s1 |
| P235 | InChIKey | VSQQQLOSPVPRAZ-RRKCRQDMSA-N |
| P665 | KEGG ID | D00391 |
| P7830 | LiverTox ID | Trifluridine |
| P6694 | MeSH concept ID | M0021960 |
| P486 | MeSH descriptor ID | D014271 |
| P672 | MeSH tree code | D03.383.742.680.705.900 |
| P672 | MeSH tree code | D13.570.230.855.900 |
| P672 | MeSH tree code | D13.570.685.705.900 |
| P6366 | Microsoft Academic ID (discontinued) | 2776167694 |
| P2115 | NDF-RT ID | N0000147083 |
| P2840 | NSC number | 75520 |
| P2840 | NSC number | 759595 |
| P2840 | NSC number | 529182 |
| P11199 | Probes And Drugs ID | PD010030 |
| P662 | PubChem CID | 6256 |
| P1579 | Reaxys registry number | 568095 |
| P3345 | RxNorm CUI | 10803 |
| P5076 | Römpp online ID | RD-20-02892 |
| P2877 | SureChEMBL ID | 3479 |
| P2892 | UMLS CUI | C0040987 |
| P11089 | UniChem compound ID | 367408 |
| P652 | UNII | RMW9V5RW38 |
| P12800 | Vikidia article ID | fr:Herpès |
| P11143 | WikiProjectMed ID | Trifluridine |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 4146 |
Why not click here or view trends?
log id: 8523295