Wikidata entity: Q23767
CaCO₃ (P274)


Quantities
| P2107 | decomposition point | 825 |
| P2107 | decomposition point | 1517 |
| P2107 | decomposition point | 2442 |
| P4250 | defined daily dose | 3 |
| P2054 | density | 2.7 |
| P2054 | density | 2.95 |
| P2067 | mass | 99.947335 |
| P2240 | median lethal dose (LD50) | 6450 |
| P1117 | pKa | 9 |
| P1109 | refractive index | 1.6 |
| P2177 | solubility | 0.001 |
| P2404 | time-weighted average exposure limit | 5 |
| P2404 | time-weighted average exposure limit | 10 |
| P2404 | time-weighted average exposure limit | 15 |
| P2119 | vapor pressure | 0 |
| P3780 | active ingredient in | ... | Q2514011 (Calcichew) | Calcichew |
| P3780 | active ingredient in | ... | Q7852695 (Tums) | Tums |
| P3335 | associated hazard | ... | Q21173346 (calcium carbonate exposure) | calcium carbonate exposure |
| P233 | canonical SMILES | String | C(=O)([O-])[O-].[Ca+2] | ??? |
| P373 | Commons category | String | Calcium carbonate | ??? |
| P556 | crystal system | ... | Q588274 (trigonal crystal system) | trigonal crystal system |
| P1343 | described by source | ... | Q124737632 (Armenian Soviet Encyclopedia, vol. 5) | Armenian Soviet Encyclopedia, vol. 5 |
| P1542 | has effect | ... | Q21173346 (calcium carbonate exposure) | calcium carbonate exposure |
| P527 | has part(s) | ... | Q629 (oxygen) | oxygen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P527 | has part(s) | ... | Q706 (calcium) | calcium |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Calcium-carbonate-xtal-3D-SF.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2175 | medical condition treated | ... | Q165328 (osteoporosis) | osteoporosis |
| P2175 | medical condition treated | ... | Q172941 (peptic ulcer disease) | peptic ulcer disease |
| P2175 | medical condition treated | ... | Q355170 (duodenal ulcer) | duodenal ulcer |
| P2175 | medical condition treated | ... | Q537297 (heartburn) | heartburn |
| P2175 | medical condition treated | ... | Q653971 (indigestion) | indigestion |
| P2175 | medical condition treated | ... | Q223591 (gastroesophageal reflux disease) | gastroesophageal reflux disease |
| P2175 | medical condition treated | ... | Q736715 (chronic renal insufficiency) | chronic renal insufficiency |
| P2175 | medical condition treated | ... | Q4003020 (gastric ulcer) | gastric ulcer |
| P2175 | medical condition treated | ... | Q1642049 (hematochezia) | hematochezia |
| P2175 | medical condition treated | ... | Q2184368 (peptic esophagitis) | peptic esophagitis |
| P5008 | on focus list of Wikimedia project | ... | Q6173448 (Wikipedia:Vital articles/Level/4) | Wikipedia:Vital articles/Level/4 |
| P4952 | safety classification and labelling | ... | Q51139288 (NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response) | NFPA 704: Standard System for the Identification of the Hazards of Materials for Emergency Response |
| P279 | subclass of | ... | Q4427704 (calcium salt) | calcium salt |
| P279 | subclass of | ... | Q56810798 (carbonate salt) | carbonate salt |
| P2868 | subject has role | ... | Q274083 (antacid) | antacid |
| P2868 | subject has role | ... | Q902638 (excipient) | excipient |
| P8061 | AGROVOC ID | c_1197 |
| P8491 | AHECC 2017 ID | 28365000 |
| P1014 | Art & Architecture Thesaurus ID | 300212174 |
| P267 | ATC code | A02AC01 |
| P267 | ATC code | A12AA04 |
| P7033 | Australian Educational Vocabulary ID | scot/3068 |
| P268 | Bibliothèque nationale de France ID | 11981073z |
| P508 | BNCF Thesaurus ID | 31082 |
| P11931 | CAMEO Chemicals ID | 25005 |
| P231 | CAS Registry Number | 471-34-1 |
| P683 | ChEBI ID | 3311 |
| P592 | ChEMBL ID | CHEMBL1200539 |
| P661 | ChemSpider ID | 9708 |
| P2027 | Colour Index International constitution ID | 77220 |
| P2027 | Colour Index International constitution ID | CI 77220 |
| P3073 | CosIng number | 32314 |
| P1036 | Dewey Decimal Classification | 546.39324 |
| P715 | DrugBank ID | DB06724 |
| P8494 | DSSTOX compound identifier | DTXCID1016238 |
| P3117 | DSSTox substance ID | DTXSID3036238 |
| P628 | E number | E170 |
| P232 | EC number | 207-439-9 |
| P2566 | ECHA Substance Infocard ID | 100.006.765 |
| P4746 | Elhuyar ZTH ID | 117959 |
| P10565 | Encyclopedia of China (Third Edition) ID | 253736 |
| P1417 | Encyclopædia Britannica Online ID | science/calcium-carbonate |
| P6262 | Fandom article ID | starwars:Calcium_carbonate |
| P646 | Freebase ID | /m/0c5pb |
| P227 | GND ID | 4132861-9 |
| P12385 | Gran Enciclopèdia Catalana ID | carbonat-de-calci |
| P1296 | Gran Enciclopèdia Catalana ID (former scheme) | 0152603 |
| P4342 | Great Norwegian Encyclopedia ID | kalsiumkarbonat |
| P2924 | Great Russian Encyclopedia Online ID (old version) | 2037538 |
| P2062 | HSDB ID | 927 |
| P2057 | Human Metabolome Database ID | HMDB0303230 |
| P5220 | ICSC ID | 1193 |
| P234 | InChI | InChI=1S/CH2O3.Ca/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 |
| P235 | InChIKey | VTYYLEPIZMXCLO-UHFFFAOYSA-L |
| P8408 | KBpedia ID | CalciumCarbonate |
| P665 | KEGG ID | D00932 |
| P665 | KEGG ID | C08129 |
| P244 | Library of Congress authority ID | sh85018780 |
| P10245 | MedlinePlus drug identifier | a601032 |
| P486 | MeSH descriptor ID | D002119 |
| P672 | MeSH tree code | D01.146.275 |
| P672 | MeSH tree code | D01.200.275.150.150 |
| P672 | MeSH tree code | D01.578.200 |
| P6366 | Microsoft Academic ID (discontinued) | 2778039128 |
| P12596 | museum-digital tag ID | 1550 |
| P12596 | museum-digital tag ID | 989 |
| P2004 | NALT ID | 21098 |
| P8189 | National Library of Israel J9U ID | 987007293773705171 |
| P950 | National Library of Spain SpMaBN ID (BNE v1.0) | XX530537 |
| P2115 | NDF-RT ID | N0000147306 |
| P2115 | NDF-RT ID | N0000146023 |
| P349 | NDL Authority ID | 00577669 |
| P691 | NL CR AUT ID | ph851920 |
| P7305 | Online PWN Encyclopedia ID | 3993896 |
| P1820 | Open Food Facts food additive ID | e170-calcium-carbonate |
| P5930 | Open Food Facts ingredient ID | calcium-carbonate |
| P10283 | OpenAlex ID | C2778039128 |
| P12594 | OSHA Occupational Chemical Database ID | 220 |
| P4235 | PatientsLikeMe treatment ID | calcium-carbonate |
| P11199 | Probes And Drugs ID | PD009243 |
| P662 | PubChem CID | 10112 |
| P662 | PubChem CID | 516889 |
| P3417 | Quora topic ID | Calcium-Carbonate |
| P657 | RTECS number | FF9335000 |
| P3345 | RxNorm CUI | 1897 |
| P10077 | Spanish Cultural Heritage thesauri ID | materias/1181638 |
| P5082 | Store medisinske leksikon ID | kalsiumkarbonat |
| P2877 | SureChEMBL ID | 3261 |
| P2892 | UMLS CUI | C0006681 |
| P652 | UNII | H0G9379FGK |
| P13591 | Yale LUX ID | concept/64fcf1af-1858-4035-bf93-6f27e6efe579 |
| P679 | ZVG number | 1650 |
Why not click here or view trends?
log id: 2071695