Wikidata entity: Q2454591
P₄S₃ (P274)

Quantities
| P2067 | mass | 219.811 |
| P233 | canonical SMILES | String | P12P3P1SP(S2)S3 | ??? |
| P373 | Commons category | String | Phosphorus sesquisulfide | ??? |
| P527 | has part(s) | ... | Q674 (phosphorus) | phosphorus |
| P527 | has part(s) | ... | Q682 (sulfur) | sulfur |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P11931 | CAMEO Chemicals ID | 1331 |
| P231 | CAS Registry Number | 1314-85-8 |
| P661 | ChemSpider ID | 14134 |
| P661 | ChemSpider ID | 21428498 |
| P8494 | DSSTOX compound identifier | DTXCID7034044 |
| P3117 | DSSTox substance ID | DTXSID4074562 |
| P232 | EC number | 215-245-0 |
| P2566 | ECHA Substance Infocard ID | 100.013.860 |
| P646 | Freebase ID | /m/08w31w |
| P7025 | HCIS ID | 4449 |
| P2062 | HSDB ID | 1257 |
| P234 | InChI | InChI=1S/P4S3/c5-1-2-3(1)7-4(5)6-2 |
| P235 | InChIKey | RWQFRHVDPXXRQN-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2777717019 |
| P662 | PubChem CID | 14818 |
| P657 | RTECS number | TH4330000 |
| P2877 | SureChEMBL ID | 609902 |
| P11089 | UniChem compound ID | 22739960 |
| P652 | UNII | 8V5Q0M194Y |
| P679 | ZVG number | 500050 |
Why not click here or view trends?
log id: 6199843