Wikidata entity: Q250455
C₆H₈O₃ (P274)
Quantities
| P2067 | mass | 128.047 |
| P233 | canonical SMILES | String | CC1C(=O)C(=C(O1)C)O | ??? |
| P373 | Commons category | String | Furaneol | ??? |
| P703 | found in taxon | ... | Q1380 (Capsicum annuum) | Capsicum annuum |
| P703 | found in taxon | ... | Q3919027 (Mangifera indica) | Mangifera indica |
| P703 | found in taxon | ... | Q181095 (Nicotiana tabacum) | Nicotiana tabacum |
| P703 | found in taxon | ... | Q1135236 (Durio zibethinus) | Durio zibethinus |
| P703 | found in taxon | ... | Q28298 (Apium graveolens) | Apium graveolens |
| P703 | found in taxon | ... | Q6855122 (Aspergillus candidus) | Aspergillus candidus |
| P366 | has use | ... | Q1979901 (perfumery) | perfumery |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P361 | part of | ... | Q28598651 (furaneol oxidoreductase activity) | furaneol oxidoreductase activity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q25403900 (food ingredient) | food ingredient |
| P231 | CAS Registry Number | 3658-77-3 |
| P683 | ChEBI ID | 76247 |
| P592 | ChEMBL ID | CHEMBL3186302 |
| P661 | ChemSpider ID | 18218 |
| P3073 | CosIng number | 75895 |
| P8494 | DSSTOX compound identifier | DTXCID8021517 |
| P3117 | DSSTox substance ID | DTXSID0041517 |
| P232 | EC number | 222-908-8 |
| P2566 | ECHA Substance Infocard ID | 100.020.826 |
| P9066 | FL number | 13.010 |
| P646 | Freebase ID | /m/03nngf9 |
| P2062 | HSDB ID | 8322 |
| P2057 | Human Metabolome Database ID | HMDB0040594 |
| P234 | InChI | InChI=1S/C6H8O3/c1-3-5(7)6(8)4(2)9-3/h3,8H,1-2H3 |
| P235 | InChIKey | INAXVXBDKKUCGI-UHFFFAOYSA-N |
| P9557 | JECFA number | 1446 |
| P2064 | KNApSAcK ID | C00052712 |
| P6366 | Microsoft Academic ID (discontinued) | 2779994474 |
| P7746 | Natural Product Atlas ID | NPA015223 |
| P9405 | NMRShiftDB structure ID | 30100587 |
| P11949 | PesticideInfo chemical ID | PRI646 |
| P11199 | Probes And Drugs ID | PD098346 |
| P662 | PubChem CID | 19309 |
| P1579 | Reaxys registry number | 1281357 |
| P3345 | RxNorm CUI | 1313733 |
| P2877 | SureChEMBL ID | 57008 |
| P11089 | UniChem compound ID | 23738225 |
| P652 | UNII | 20PI8YZP7A |
Why not click here or view trends?
log id: 6575526