Wikidata entity: Q2506823
C₉H₁₃N (P274)
Quantities
| P2067 | mass | 135.105 |
| P233 | canonical SMILES | String | CC(CC1=CC=CC=C1)N | ??? |
| P373 | Commons category | String | Levoamphetamine | ??? |
| P1343 | described by source | ... | Q316572 (Opium Law) | Opium Law |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/L-amphetamine-3D-vdW.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C[C@H](CC1=CC=CC=C1)N | ??? |
| P2175 | medical condition treated | ... | Q181923 (attention deficit hyperactivity disorder) | attention deficit hyperactivity disorder |
| P2175 | medical condition treated | ... | Q189561 (narcolepsy) | narcolepsy |
| P129 | physically interacts with | ... | Q11071075 (Trace amine associated receptor 1) | Trace amine associated receptor 1 |
| P129 | physically interacts with | ... | Q21991520 (Trace amine-associated receptor 1) | Trace amine-associated receptor 1 |
| P3364 | stereoisomer of | ... | Q1706418 (dextroamphetamine) | dextroamphetamine |
| P279 | subclass of | ... | Q179452 (DL-amphetamine) | DL-amphetamine |
| P231 | CAS Registry Number | 156-34-3 |
| P683 | ChEBI ID | 42724 |
| P592 | ChEMBL ID | CHEMBL19393 |
| P661 | ChemSpider ID | 30477 |
| P11198 | DrugCentral ID | 1562 |
| P8494 | DSSTOX compound identifier | DTXCID4088507 |
| P3117 | DSSTox substance ID | DTXSID20166016 |
| P232 | EC number | 205-850-8 |
| P2566 | ECHA Substance Infocard ID | 100.005.320 |
| P646 | Freebase ID | /m/09gjq7k |
| P1578 | Gmelin number | 1125855 |
| P595 | Guide to Pharmacology Ligand ID | 2146 |
| P2057 | Human Metabolome Database ID | HMDB0012128 |
| P234 | InChI | InChI=1S/C9H13N/c1-8(10)7-9-5-3-2-4-6-9/h2-6,8H,7,10H2,1H3/t8-/m1/s1 |
| P235 | InChIKey | KWTSXDURSIMDCE-MRVPVSSYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2777720001 |
| P3636 | PDB ligand ID | FRD |
| P638 | PDB structure ID | 2AOH |
| P638 | PDB structure ID | 2AOF |
| P638 | PDB structure ID | 2AOJ |
| P638 | PDB structure ID | 2AOI |
| P11199 | Probes And Drugs ID | PD013916 |
| P662 | PubChem CID | 32893 |
| P1579 | Reaxys registry number | 2432739 |
| P2877 | SureChEMBL ID | 2636 |
| P11089 | UniChem compound ID | 530800 |
| P652 | UNII | R87US8P740 |
Why not click here or view trends?
log id: 87480