Wikidata entity: Q2506962
C₁₁H₁₅NO₂ (P274)
Quantities
| P2067 | mass | 193.11 |
| P233 | canonical SMILES | String | CC(C(=O)C1=CC=C(C=C1)OC)NC | ??? |
| P373 | Commons category | String | Methedrone | ??? |
| P1889 | different from | ... | Q262613 (mephedrone) | mephedrone |
| P1889 | different from | ... | Q191924 (D-methamphetamine) | D-methamphetamine |
| P527 | has part(s) | ... | Q627 (nitrogen) | nitrogen |
| P527 | has part(s) | ... | Q623 (carbon) | carbon |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P231 | CAS Registry Number | 530-54-1 |
| P592 | ChEMBL ID | CHEMBL2106893 |
| P661 | ChemSpider ID | 187475 |
| P3117 | DSSTox substance ID | DTXSID20862127 |
| P232 | EC number | 684-468-7 |
| P2566 | ECHA Substance Infocard ID | 100.209.920 |
| P646 | Freebase ID | /m/03cdt8b |
| P2057 | Human Metabolome Database ID | HMDB0243795 |
| P234 | InChI | InChI=1S/C11H15NO2/c1-8(12-2)11(13)9-4-6-10(14-3)7-5-9/h4-8,12H,1-3H3 |
| P235 | InChIKey | MQUIHBQDYYAEMH-UHFFFAOYSA-N |
| P6366 | Microsoft Academic ID (discontinued) | 2776532383 |
| P11199 | Probes And Drugs ID | PD019815 |
| P662 | PubChem CID | 216281 |
| P2877 | SureChEMBL ID | 729034 |
| P11089 | UniChem compound ID | 22895325 |
| P652 | UNII | L7HY239I58 |
Why not click here or view trends?
log id: 3854828