Wikidata entity: Q261167
C₁₄H₁₈N₂O (P274)
Quantities
| P2067 | mass | 230.142 |
| P233 | canonical SMILES | String | CC(C)C1=NN2C=CC=CC2=C1C(=O)C(C)C | ??? |
| P373 | Commons category | String | Ibudilast | ??? |
| P366 | has use | ... | Q12140 (medication) | medication |
| P8224 | image of molecular model or crystal lattice model | CommonsMedia | http://commons.wikimedia.org/wiki/Special:FilePath/Ibudilast%20molecule%20ball.png | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q410798 (Phosphodiesterase 5A) | Phosphodiesterase 5A |
| P129 | physically interacts with | ... | Q21117805 (Phosphodiesterase 4A) | Phosphodiesterase 4A |
| P129 | physically interacts with | ... | Q21119706 (Phosphodiesterase 10A) | Phosphodiesterase 10A |
| P129 | physically interacts with | ... | Q21123242 (Phosphodiesterase 4B) | Phosphodiesterase 4B |
| P129 | physically interacts with | ... | Q21123247 (Phosphodiesterase 3A) | Phosphodiesterase 3A |
| P129 | physically interacts with | ... | Q21202200 (Phosphodiesterase 4C) | Phosphodiesterase 4C |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q418251 (phosphodiesterase inhibitor) | phosphodiesterase inhibitor |
| P2868 | subject has role | ... | Q721432 (platelet aggregation inhibitors) | platelet aggregation inhibitors |
| P2868 | subject has role | ... | Q927234 (bronchodilator) | bronchodilator |
| P2868 | subject has role | ... | Q4008956 (vasodilator agent) | vasodilator agent |
| P2275 | World Health Organisation international non-proprietary name | Monolingualtext | ibudilast | ??? |
| P267 | ATC code | R03DC04 |
| P231 | CAS Registry Number | 50847-11-5 |
| P683 | ChEBI ID | 31684 |
| P592 | ChEMBL ID | CHEMBL19449 |
| P661 | ChemSpider ID | 3543 |
| P715 | DrugBank ID | DB05266 |
| P11198 | DrugCentral ID | 1406 |
| P8494 | DSSTOX compound identifier | DTXCID2028933 |
| P3117 | DSSTox substance ID | DTXSID7049007 |
| P232 | EC number | 637-150-7 |
| P2566 | ECHA Substance Infocard ID | 100.164.881 |
| P646 | Freebase ID | /m/03d2nmz |
| P595 | Guide to Pharmacology Ligand ID | 7399 |
| P2057 | Human Metabolome Database ID | HMDB0015614 |
| P234 | InChI | InChI=1S/C14H18N2O/c1-9(2)13-12(14(17)10(3)4)11-7-5-6-8-16(11)15-13/h5-10H,1-4H3 |
| P235 | InChIKey | ZJVFLBOZORBYFE-UHFFFAOYSA-N |
| P665 | KEGG ID | D01385 |
| P486 | MeSH descriptor ID | C038366 |
| P6366 | Microsoft Academic ID (discontinued) | 2776892393 |
| P3636 | PDB ligand ID | AVL |
| P638 | PDB structure ID | 4GRQ |
| P11199 | Probes And Drugs ID | PD002711 |
| P662 | PubChem CID | 3671 |
| P2877 | SureChEMBL ID | 30390 |
| P11089 | UniChem compound ID | 67859 |
| P652 | UNII | M0TTH61XC5 |
| P3350 | World Health Organisation international non-proprietary name numeric ID | 6068 |
Why not click here or view trends?
log id: 6816384