Abstract is: Benzo[e]pyrene is a polycyclic aromatic hydrocarbon with the chemical formula C20H12. It is listed as a Group 3 carcinogen by the IARC.
P11931 | CAMEO Chemicals ID | 19865 |
P11160 | Cannabis Database ID | 005915 |
P233 | canonical SMILES | C1=CC=C2C(=C1)C3=CC=CC4=C3C5=C(C=CC=C25)C=C4 |
P231 | CAS Registry Number | 192-97-2 |
P683 | ChEBI ID | 34567 |
P592 | ChEMBL ID | CHEMBL1371125 |
P661 | ChemSpider ID | 8774 |
P8494 | DSSTOX compound identifier | DTXCID103764 |
P3117 | DSSTox substance ID | DTXSID3023764 |
P232 | EC number | 205-892-7 |
P2566 | ECHA Substance Infocard ID | 100.005.358 |
P646 | Freebase ID | /m/076zyzf |
P7025 | HCIS ID | 427 |
P2062 | HSDB ID | 4031 |
P2057 | Human Metabolome Database ID | HMDB0249007 |
P4168 | IEDB Epitope ID | 119717 |
P234 | InChI | InChI=1S/C20H12/c1-2-8-16-15(7-1)17-9-3-5-13-11-12-14-6-4-10-18(16)20(14)19(13)17/h1-12H |
P235 | InChIKey | TXVHTIQJNYSSKO-UHFFFAOYSA-N |
P665 | KEGG ID | C14435 |
P6689 | MassBank accession ID | MSBNK-Fac_Eng_Univ_Tokyo-JP012369 |
P6366 | Microsoft Academic ID | 2777699546 |
P2840 | NSC number | 89273 |
P11199 | Probes And Drugs ID | PD075816 |
P662 | PubChem CID | 9128 |
P1579 | Reaxys registry number | 1911334 |
P4964 | SPLASH | splash10-0udi-0090000000-057dde1b8cc3d08819d3 |
P11089 | UniChem compound ID | 915210 |
P652 | UNII | 63APT6398R |
P679 | ZVG number | 102869 |
P703 | found in taxon | Nicotiana tabacum | Q181095 |
P2067 | mass | 252.094 |
FileName: Benzo(e)pyrene 200.svg
Description: Structure of benzo[e]pyrene
License: Public domain