Wikidata entity: Q2650256
C₁₉H₂₉N₅O₂ (P274)
Quantities
| P2067 | mass | 359.232 |
| P233 | canonical SMILES | String | CC1(CC(=O)N(C(=O)C1)CCCCN2CCN(CC2)C3=NC=CC=N3)C | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P129 | physically interacts with | ... | Q21115043 (5-hydroxytryptamine receptor 1A) | 5-hydroxytryptamine receptor 1A |
| P279 | subclass of | ... | Q11173 (chemical compound) | chemical compound |
| P2868 | subject has role | ... | Q62903 (anxiolytic) | anxiolytic |
| P2868 | subject has role | ... | Q76560 (antidepressant) | antidepressant |
| P2868 | subject has role | ... | Q7455050 (serotonin receptor agonists) | serotonin receptor agonists |
| P267 | ATC code | N06AX19 |
| P231 | CAS Registry Number | 83928-76-1 |
| P683 | ChEBI ID | 135990 |
| P592 | ChEMBL ID | CHEMBL284092 |
| P661 | ChemSpider ID | 49836 |
| P715 | DrugBank ID | DB12184 |
| P11198 | DrugCentral ID | 4562 |
| P8494 | DSSTOX compound identifier | DTXCID20155304 |
| P3117 | DSSTox substance ID | DTXSID90232813 |
| P646 | Freebase ID | /m/02rk6dh |
| P2057 | Human Metabolome Database ID | HMDB0252698 |
| P234 | InChI | InChI=1S/C19H29N5O2/c1-19(2)14-16(25)24(17(26)15-19)9-4-3-8-22-10-12-23(13-11-22)18-20-6-5-7-21-18/h5-7H,3-4,8-15H2,1-2H3 |
| P235 | InChIKey | QOIGKGMMAGJZNZ-UHFFFAOYSA-N |
| P486 | MeSH descriptor ID | C039979 |
| P6366 | Microsoft Academic ID (discontinued) | 2779096726 |
| P11199 | Probes And Drugs ID | PD072027 |
| P662 | PubChem CID | 55191 |
| P2877 | SureChEMBL ID | 79040 |
| P11089 | UniChem compound ID | 344322 |
| P652 | UNII | JW5Y7B8Z18 |
| P11143 | WikiProjectMed ID | Gepirone |
Why not click here or view trends?
log id: 6040786