Wikidata entity: Q26841322
C₈H₁₁NO₃ (P274)
Quantities
| P2067 | mass | 169.074 |
| P233 | canonical SMILES | String | C1=CC(=C(C=C1C(CN)O)O)O | ??? |
| P31 | instance of | ... | Q113145171 (type of chemical entity) | type of chemical entity |
| P2017 | isomeric SMILES | String | C1=CC(=C(C=C1[C@@H](CN)O)O)O | ??? |
| P3364 | stereoisomer of | ... | Q186242 (norepinephrine) | norepinephrine |
| P279 | subclass of | ... | Q27087994 ((+/-)-noradrenaline) | (+/-)-noradrenaline |
| P231 | CAS Registry Number | 149-95-1 |
| P683 | ChEBI ID | 33571 |
| P592 | ChEMBL ID | CHEMBL18824 |
| P661 | ChemSpider ID | 5609 |
| P3117 | DSSTox substance ID | DTXSID901316081 |
| P232 | EC number | 205-750-4 |
| P2566 | ECHA Substance Infocard ID | 100.005.229 |
| P234 | InChI | InChI=1S/C8H11NO3/c9-4-8(12)5-1-2-6(10)7(11)3-5/h1-3,8,10-12H,4,9H2/t8-/m1/s1 |
| P235 | InChIKey | SFLSHLFXELFNJZ-MRVPVSSYSA-N |
| P662 | PubChem CID | 5814 |
| P1579 | Reaxys registry number | 2937999 |
| P2877 | SureChEMBL ID | 3489077 |
| P2877 | SureChEMBL ID | 29460319 |
| P11089 | UniChem compound ID | 650378 |
| P652 | UNII | 887AEE91JI |
Why not click here or view trends?
log id: 2139104